EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12I6N2O6.2C7H18NO5 |
| Net Charge | 0 |
| Average Mass | 1530.194 |
| Monoisotopic Mass | 1529.73337 |
| SMILES | C[NH2+]C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.C[NH2+]C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(CCCCC(=O)Nc1c(I)cc(I)c(C(=O)[O-])c1I)Nc1c(I)cc(I)c(C(=O)[O-])c1I |
| InChI | InChI=1S/C20H14I6N2O6.2C7H17NO5/c21-7-5-9(23)17(15(25)13(7)19(31)32)27-11(29)3-1-2-4-12(30)28-18-10(24)6-8(22)14(16(18)26)20(33)34;2*1-8-2-4(10)6(12)7(13)5(11)3-9/h5-6H,1-4H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34);2*4-13H,2-3H2,1H3/t;2*4-,5+,6+,7+/m.00/s1 |
| InChIKey | DGIAUNUPXILTJW-VRWDCWMNSA-N |
| Roles Classification |
|---|
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodipamide dimeglumine (CHEBI:31704) has part adipiodone(2−) (CHEBI:145091) |
| iodipamide dimeglumine (CHEBI:31704) has role radioopaque medium (CHEBI:37338) |
| iodipamide dimeglumine (CHEBI:31704) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| bis[1-deoxy-1-(methylazaniumyl)-D-glucitol] 3,3'-[(1,6-dioxohexane-1,6-diyl)diimino]bis(2,4,6-triiodobenzoate) |
| Synonyms | Source |
|---|---|
| iodipamide meglumine | KEGG DRUG |
| adipiodone meglumine | DrugBank |
| adipiodone meglumine injection | ChemIDplus |
| meglumine adipiodone | DrugBank |
| meglumine iodipamide | DrugBank |
| iodipamide meglumine salt | ChemIDplus |
| Brand Names | Source |
|---|---|
| Cholografin meglumine | KEGG DRUG |
| Biligrafin forte | ChemIDplus |
| Cavumbren | ChemIDplus |
| Endocistobil | ChemIDplus |
| Endografin | ChemIDplus |
| Intrablix | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01916 | KEGG DRUG |
| DBSALT001312 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:3521-84-4 | KEGG COMPOUND |
| CAS:3521-84-4 | ChemIDplus |
| Citations |
|---|