EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11I3N2O4 |
| Net Charge | 0 |
| Average Mass | 627.942 |
| Monoisotopic Mass | 627.78530 |
| SMILES | CC(=O)NCc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C12H11I3N2O4/c1-4(18)16-3-6-8(13)7(12(20)21)10(15)11(9(6)14)17-5(2)19/h3H2,1-2H3,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | VVDGWALACJEJKG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodamide (CHEBI:31703) has role radioopaque medium (CHEBI:37338) |
| iodamide (CHEBI:31703) is a benzoic acids (CHEBI:22723) |
| iodamide (CHEBI:31703) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid |
| INNs | Source |
|---|---|
| iodamida | ChemIDplus |
| iodamide | ChemIDplus |
| iodamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| alpha,5-Diacetamido-2,4,6-triiodo-m-toluic acid | ChemIDplus |
| Ametriiodic acid | ChemIDplus |
| Ametriiodinic acid | ChemIDplus |
| Urombrine | ChemIDplus |
| Citations |
|---|