EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28I3N3O9 |
| Net Charge | 0 |
| Average Mass | 835.168 |
| Monoisotopic Mass | 834.89597 |
| SMILES | CN(CC(O)CO)C(=O)c1c(I)c(NC(=O)C(CO)CO)c(I)c(C(=O)N(C)CC(O)CO)c1I |
| InChI | InChI=1S/C20H28I3N3O9/c1-25(3-10(31)7-29)19(34)12-14(21)13(20(35)26(2)4-11(32)8-30)16(23)17(15(12)22)24-18(33)9(5-27)6-28/h9-11,27-32H,3-8H2,1-2H3,(H,24,33) |
| InChIKey | YLPBXIKWXNRACS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iobitridol (CHEBI:31701) has role environmental contaminant (CHEBI:78298) |
| iobitridol (CHEBI:31701) has role radioopaque medium (CHEBI:37338) |
| iobitridol (CHEBI:31701) has role xenobiotic (CHEBI:35703) |
| iobitridol (CHEBI:31701) is a benzenedicarboxamide (CHEBI:38800) |
| iobitridol (CHEBI:31701) is a hexol (CHEBI:37206) |
| iobitridol (CHEBI:31701) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| N,N'-bis(2,3-dihydroxypropyl)-5-{[3-hydroxy-2-(hydroxymethyl)propanoyl]amino}-2,4,6-triiodo-N,N'-dimethylbenzene-1,3-dicarboxamide |
| Synonym | Source |
|---|---|
| N,N'-bis(2,3-dihydroxypropyl)-5-(2-(hydroxymethyl)hydracrylamido)-2,4,6-triiodo-N,N'-dimethylisophthalamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01181 | KEGG DRUG |
| Iobitridol | Wikipedia |
| 1449 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8178996 | Reaxys |
| CAS:136949-58-1 | ChemIDplus |
| Citations |
|---|