EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H47N2O6S2.Na |
| Net Charge | 0 |
| Average Mass | 774.981 |
| Monoisotopic Mass | 774.27732 |
| SMILES | [H]C(=C([H])C([H])=C([H])C1=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c2C1(C)C)C([H])=C([H])C([H])=C1N(CCCCS(=O)(=O)[O-])c2ccc3ccccc3c2C1(C)C.[Na+] |
| InChI | InChI=1S/C43H48N2O6S2.Na/c1-42(2)38(44(28-14-16-30-52(46,47)48)36-26-24-32-18-10-12-20-34(32)40(36)42)22-8-6-5-7-9-23-39-43(3,4)41-35-21-13-11-19-33(35)25-27-37(41)45(39)29-15-17-31-53(49,50)51;/h5-13,18-27H,14-17,28-31H2,1-4H3,(H-,46,47,48,49,50,51);/q;+1/p-1 |
| InChIKey | MOFVSTNWEDAEEK-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indocyanine green (CHEBI:31696) is a 1,1-diunsubstituted alkanesulfonate (CHEBI:62081) |
| indocyanine green (CHEBI:31696) is a benzoindole (CHEBI:38111) |
| indocyanine green (CHEBI:31696) is a cyanine dye (CHEBI:37960) |
| IUPAC Name |
|---|
| sodium 4-(2-{7-[1,1-dimethyl-3-(4-sulfonatobutyl)-1H-benzo[e]indolium-2-yl]hepta-2,4,6-trien-1-ylidene}-1,1-dimethyl-1,2-dihydro-3H-benzo[e]indol-3-yl)butane-1-sulfonate |
| Synonyms | Source |
|---|---|
| Cardio-Green | ChemIDplus |
| Fox Green | ChemIDplus |
| indocyanine green | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01342 | KEGG DRUG |
| Indocyanine_Green | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4115884 | Beilstein |
| CAS:3599-32-4 | ChemIDplus |