EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H8N2O8S2.2Na |
| Net Charge | 0 |
| Average Mass | 466.360 |
| Monoisotopic Mass | 465.95175 |
| SMILES | O=C1/C(=C2\Nc3ccc(S(=O)(=O)[O-])cc3C2=O)Nc2ccc(S(=O)(=O)[O-])cc21.[Na+].[Na+] |
| InChI | InChI=1S/C16H10N2O8S2.2Na/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14;;/h1-6,17-18H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b14-13+;; |
| InChIKey | KHLVKKOJDHCJMG-QDBORUFSSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Biological Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Applications: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. two-colour indicator A colour indicator that possesses a different colour on each side of the transition interval. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indigo carmine (CHEBI:31695) has part indigo carmine(2−) (CHEBI:90120) |
| indigo carmine (CHEBI:31695) has role food colouring (CHEBI:77182) |
| indigo carmine (CHEBI:31695) has role histological dye (CHEBI:77178) |
| indigo carmine (CHEBI:31695) has role two-colour indicator (CHEBI:50412) |
| indigo carmine (CHEBI:31695) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium (2E)-3-oxo-2-(3-oxo-5-sulfonato-1,3-dihydro-2H-indol-2-ylidene)-2,3-dihydro-1H-indole-5-sulfonate |
| Synonyms | Source |
|---|---|
| C.I. Acid Blue 74 | ChemIDplus |
| C.I. Food Blue 1 | ChemIDplus |
| C.I. Food Blue 1, disodium salt | ChemIDplus |
| C.I. Natural Blue 2 | ChemIDplus |
| Disodium 3,3'-dioxo-(delta2,2'-biindoline)-5,5'-disulfonate | ChemIDplus |
| Disodium 5,5'-disulfoindigo | ChemIDplus |
| Brand Names | Source |
|---|---|
| Acid blue 74 | ChEBI |
| C.I. 73015 | ChEBI |
| C.I. 75781 | ChEBI |
| Indigo carmine | KEGG DRUG |
| Natural blue 2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01563 | KEGG DRUG |
| HMDB0059912 | HMDB |
| Indigo_carmine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:905434 | Reaxys |
| CAS:860-22-0 | KEGG COMPOUND |
| CAS:860-22-0 | ChemIDplus |
| Citations |
|---|