EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14N2O6S |
| Net Charge | 0 |
| Average Mass | 374.374 |
| Monoisotopic Mass | 374.05726 |
| SMILES | CS(=O)(=O)Nc1cc2occ(NC=O)c(=O)c2cc1Oc1ccccc1 |
| InChI | InChI=1S/C17H14N2O6S/c1-26(22,23)19-13-8-15-12(17(21)14(9-24-15)18-10-20)7-16(13)25-11-5-3-2-4-6-11/h2-10,19H,1H3,(H,18,20) |
| InChIKey | ANMATWQYLIFGOK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iguratimod (CHEBI:31689) has role anti-inflammatory agent (CHEBI:67079) |
| Iguratimod (CHEBI:31689) has role antirheumatic drug (CHEBI:35842) |
| Iguratimod (CHEBI:31689) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| careram | DrugCentral |
| Iguratimod | KEGG COMPOUND |
| kolbet | DrugCentral |
| T-614 | DrugCentral |
| Citations |
|---|