EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C21H27NO2.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 800.990 |
| Monoisotopic Mass | 800.42480 |
| SMILES | CC(C(O)c1ccc(O)cc1)N1CCC(Cc2ccccc2)CC1.CC(C(O)c1ccc(O)cc1)N1CCC(Cc2ccccc2)CC1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C21H27NO2.C4H6O6/c2*1-16(21(24)19-7-9-20(23)10-8-19)22-13-11-18(12-14-22)15-17-5-3-2-4-6-17;5-1(3(7)8)2(6)4(9)10/h2*2-10,16,18,21,23-24H,11-15H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t;;1-,2-/m..1/s1 |
| InChIKey | DMPRDSPPYMZQBT-CEAXSRTFSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ifenprodil tartrate (CHEBI:31688) has role antidepressant (CHEBI:35469) |
| Ifenprodil tartrate (CHEBI:31688) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Ifenprodil hemitartrate | ChEMBL |
| Ifenprodil tartrate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01445 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:23210-58-4 | KEGG COMPOUND |