EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O5 |
| Net Charge | 0 |
| Average Mass | 338.444 |
| Monoisotopic Mass | 338.20932 |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCO)=C(C)C1=O |
| InChI | InChI=1S/C19H30O5/c1-14-15(12-10-8-6-4-5-7-9-11-13-20)17(22)19(24-3)18(23-2)16(14)21/h20H,4-13H2,1-3H3 |
| InChIKey | JGPMMRGNQUBGND-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Application: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| idebenone (CHEBI:31687) has role antioxidant (CHEBI:22586) |
| idebenone (CHEBI:31687) has role ferroptosis inhibitor (CHEBI:173084) |
| idebenone (CHEBI:31687) has role immunosuppressive agent (CHEBI:35705) |
| idebenone (CHEBI:31687) is a 1,4-benzoquinones (CHEBI:132124) |
| idebenone (CHEBI:31687) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methyl-1,4-benzoquinone |
| INNs | Source |
|---|---|
| idebenona | WHO MedNet |
| idebenone | WHO MedNet |
| idébénone | WHO MedNet |
| idebenonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione | IUPAC |
| 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methyl-p-benzoquinone | ChemIDplus |
| 2,3-dimethoxy-5-methyl-6-(10'-hydroxydecyl)-1,4-benzoquinone | ChEBI |
| 6-(10-hydroxydecyl)-2,3-dimethoxy-5-methyl-1,4-benzoquinone | ChemIDplus |
| 6-(10-hydroxydecyl)-2,3-dimethoxy-5-methyl-p-benzoquinone | ChEBI |
| CV 2619 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Raxone | DrugBank |
| Citations |
|---|