EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O5 |
| Net Charge | 0 |
| Average Mass | 338.444 |
| Monoisotopic Mass | 338.20932 |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCO)=C(C)C1=O |
| InChI | InChI=1S/C19H30O5/c1-14-15(12-10-8-6-4-5-7-9-11-13-20)17(22)19(24-3)18(23-2)16(14)21/h20H,4-13H2,1-3H3 |
| InChIKey | JGPMMRGNQUBGND-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| idebenone (CHEBI:31687) has role antioxidant (CHEBI:22586) |
| idebenone (CHEBI:31687) has role ferroptosis inhibitor (CHEBI:173084) |
| idebenone (CHEBI:31687) is a 1,4-benzoquinones (CHEBI:132124) |
| idebenone (CHEBI:31687) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methyl-1,4-benzoquinone |
| INNs | Source |
|---|---|
| idebenona | WHO MedNet |
| idébénone | WHO MedNet |
| idebenonum | WHO MedNet |
| idebenone | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-(10-hydroxydecyl)-2,3-dimethoxy-5-methyl-p-benzoquinone | ChEBI |
| 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methyl-p-benzoquinone | ChemIDplus |
| CV 2619 | ChemIDplus |
| 6-(10-hydroxydecyl)-2,3-dimethoxy-5-methyl-1,4-benzoquinone | ChemIDplus |
| 2,3-dimethoxy-5-methyl-6-(10'-hydroxydecyl)-1,4-benzoquinone | ChEBI |
| 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione | IUPAC |
| Brand Name | Source |
|---|---|
| Raxone | DrugBank |
| Citations |
|---|