EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)/C=C/[C@H](C)C(C)C |
| InChI | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20+,22-,23-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | OILXMJHPFNGGTO-ZAUYPBDWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloromorum sp. toxicum (ncbitaxon:299907) | - | PubMed (18620714) | |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (15489546) | |
| Salmo salar (ncbitaxon:8030) | - | PubMed (29397797) | |
| Schisandra chinensis (ncbitaxon:50507) | fruit (BTO:0000486) | PubMed (30853340) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of Δ24-sterol reductase (EC 1.3.1.72). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brassicasterol (CHEBI:3168) has role algal metabolite (CHEBI:84735) |
| brassicasterol (CHEBI:3168) has role animal metabolite (CHEBI:75767) |
| brassicasterol (CHEBI:3168) has role biomarker (CHEBI:59163) |
| brassicasterol (CHEBI:3168) has role EC 1.3.1.72 (Δ24-sterol reductase) inhibitor (CHEBI:78728) |
| brassicasterol (CHEBI:3168) has role human metabolite (CHEBI:77746) |
| brassicasterol (CHEBI:3168) has role marine metabolite (CHEBI:76507) |
| brassicasterol (CHEBI:3168) has role plant metabolite (CHEBI:76924) |
| brassicasterol (CHEBI:3168) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| brassicasterol (CHEBI:3168) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| brassicasterol (CHEBI:3168) is a 3β-sterol (CHEBI:35348) |
| brassicasterol (CHEBI:3168) is a ergostanoid (CHEBI:50403) |
| brassicasterol (CHEBI:3168) is a phytosterols (CHEBI:26125) |
| Incoming Relation(s) |
| brassicasterol 3-β-D-glucoside (CHEBI:145041) has functional parent brassicasterol (CHEBI:3168) |
| IUPAC Name |
|---|
| (22E)-ergosta-5,22-dien-3β-ol |
| Synonyms | Source |
|---|---|
| (22E,24R)-24-methylcholesta-5,22-dien-3β-ol | ChEBI |
| 24(R)-methylcholesta-5,22E-dien-3β-ol | HMDB |
| 24-methyl cholest-5,22-dien-3β-ol | ChEBI |
| (3β,22E)-ergosta-5,22-dien-3-ol | ChEBI |
| brassicasterin | NIST Chemistry WebBook |
| ergosta-5,22E-dien-3β-ol | HMDB |
| UniProt Name | Source |
|---|---|
| brassicasterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Brassicasterol | Wikipedia |
| C00003646 | KNApSAcK |
| C08813 | KEGG COMPOUND |
| CPD-4161 | MetaCyc |
| FDB012496 | FooDB |
| HMDB0011181 | HMDB |
| LMST01030098 | LIPID MAPS |
| Citations |
|---|