EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)/C=C/[C@H](C)C(C)C |
| InChI | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20+,22-,23-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | OILXMJHPFNGGTO-ZAUYPBDWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chloromorum sp. toxicum (ncbitaxon:299907) | - | PubMed (18620714) | |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (15489546) | |
| Salmo salar (ncbitaxon:8030) | - | PubMed (29397797) | |
| Schisandra chinensis (ncbitaxon:50507) | fruit (BTO:0000486) | PubMed (30853340) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of Δ24-sterol reductase (EC 1.3.1.72). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brassicasterol (CHEBI:3168) has role algal metabolite (CHEBI:84735) |
| brassicasterol (CHEBI:3168) has role animal metabolite (CHEBI:75767) |
| brassicasterol (CHEBI:3168) has role biomarker (CHEBI:59163) |
| brassicasterol (CHEBI:3168) has role EC 1.3.1.72 (Δ24-sterol reductase) inhibitor (CHEBI:78728) |
| brassicasterol (CHEBI:3168) has role human metabolite (CHEBI:77746) |
| brassicasterol (CHEBI:3168) has role marine metabolite (CHEBI:76507) |
| brassicasterol (CHEBI:3168) has role plant metabolite (CHEBI:76924) |
| brassicasterol (CHEBI:3168) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| brassicasterol (CHEBI:3168) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| brassicasterol (CHEBI:3168) is a 3β-sterol (CHEBI:35348) |
| brassicasterol (CHEBI:3168) is a ergostanoid (CHEBI:50403) |
| brassicasterol (CHEBI:3168) is a phytosterols (CHEBI:26125) |
| Incoming Relation(s) |
| brassicasterol 3-β-D-glucoside (CHEBI:145041) has functional parent brassicasterol (CHEBI:3168) |
| IUPAC Name |
|---|
| (22E)-ergosta-5,22-dien-3β-ol |
| Synonyms | Source |
|---|---|
| (22E,24R)-24-methylcholesta-5,22-dien-3β-ol | ChEBI |
| 24(R)-methylcholesta-5,22E-dien-3β-ol | HMDB |
| 24-methyl cholest-5,22-dien-3β-ol | ChEBI |
| (3β,22E)-ergosta-5,22-dien-3-ol | ChEBI |
| brassicasterin | NIST Chemistry WebBook |
| ergosta-5,22E-dien-3β-ol | HMDB |
| UniProt Name | Source |
|---|---|
| brassicasterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Brassicasterol | Wikipedia |
| C00003646 | KNApSAcK |
| C08813 | KEGG COMPOUND |
| CPD-4161 | MetaCyc |
| FDB012496 | FooDB |
| HMDB0011181 | HMDB |
| LMST01030098 | LIPID MAPS |
| Citations |
|---|