EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O6 |
| Net Charge | 0 |
| Average Mass | 432.557 |
| Monoisotopic Mass | 432.25119 |
| SMILES | [H][C@@]12CC[C@](OC(=O)CCC)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C25H36O6/c1-4-5-21(30)31-25(20(29)14-26)11-9-18-17-7-6-15-12-16(27)8-10-23(15,2)22(17)19(28)13-24(18,25)3/h12,17-19,22,26,28H,4-11,13-14H2,1-3H3/t17-,18-,19-,22+,23-,24-,25-/m0/s1 |
| InChIKey | BMCQMVFGOVHVNG-TUFAYURCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cortisol 17-butyrate (CHEBI:31674) has role dermatologic drug (CHEBI:50177) |
| cortisol 17-butyrate (CHEBI:31674) has role drug allergen (CHEBI:88188) |
| cortisol 17-butyrate (CHEBI:31674) is a butyrate ester (CHEBI:50477) |
| cortisol 17-butyrate (CHEBI:31674) is a cortisol ester (CHEBI:23396) |
| cortisol 17-butyrate (CHEBI:31674) is a primary α-hydroxy ketone (CHEBI:139590) |
| IUPAC Name |
|---|
| 11β,21-dihydroxy-3,20-dioxopregn-4-en-17-yl butanoate |
| Synonyms | Source |
|---|---|
| 11β,21-dihydroxy-17α-butyryloxy-4-pregnene-3,20-dione | ChEBI |
| 17-O-butyrylcortisol | ChEBI |
| H-17-B | ChEBI |
| Hydrocortisone-17alpha-butyrate | ChemIDplus |
| Hydrocortisone 17-butyrate | ChemIDplus |
| Hydrocortisone butyrate | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 3959 | DrugCentral |
| D01619 | KEGG DRUG |
| DB00741 | DrugBank |
| Hydrocortisone-17-Butyrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3634702 | Reaxys |
| CAS:13609-67-1 | KEGG DRUG |
| CAS:13609-67-1 | ChemIDplus |
| Citations |
|---|