EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H41ClFNO3 |
| Net Charge | 0 |
| Average Mass | 530.124 |
| Monoisotopic Mass | 529.27590 |
| SMILES | CCCCCCCCCC(=O)OC1(c2ccc(Cl)cc2)CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C31H41ClFNO3/c1-2-3-4-5-6-7-8-11-30(36)37-31(26-14-16-27(32)17-15-26)20-23-34(24-21-31)22-9-10-29(35)25-12-18-28(33)19-13-25/h12-19H,2-11,20-24H2,1H3 |
| InChIKey | GUTXTARXLVFHDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Haloperidol decanoate (CHEBI:31664) has role antipsychotic agent (CHEBI:35476) |
| Haloperidol decanoate (CHEBI:31664) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| haldol decanoate | DrugCentral |
| Haloperidol decanoate | KEGG COMPOUND |
| R-13,672 | ChEMBL |
| R-13672 | ChEMBL |
| Brand Name | Source |
|---|---|
| Haldol dec | ChEMBL |
| Citations |
|---|