EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O3S |
| Net Charge | 0 |
| Average Mass | 323.418 |
| Monoisotopic Mass | 323.13036 |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NN2CC3CCCC3C2)cc1 |
| InChI | InChI=1S/C15H21N3O3S/c1-11-5-7-14(8-6-11)22(20,21)17-15(19)16-18-9-12-3-2-4-13(12)10-18/h5-8,12-13H,2-4,9-10H2,1H3,(H2,16,17,19) |
| InChIKey | BOVGTQGAOIONJV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | insulin secretagogue A secretagogue that causes the secretion of insulin. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gliclazide (CHEBI:31654) has role anticonvulsant (CHEBI:35623) |
| gliclazide (CHEBI:31654) has role hypoglycemic agent (CHEBI:35526) |
| gliclazide (CHEBI:31654) has role insulin secretagogue (CHEBI:90415) |
| gliclazide (CHEBI:31654) has role radical scavenger (CHEBI:48578) |
| gliclazide (CHEBI:31654) is a N-sulfonylurea (CHEBI:76983) |
| IUPAC Name |
|---|
| N-(hexahydrocyclopenta[c]pyrrol-2(1H)-ylcarbamoyl)-4-methylbenzenesulfonamide |
| INN | Source |
|---|---|
| gliclazida | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(3-azabicyclo(3.3.0)oct-3-yl)-3-(p-tolylsulfonyl)urea | ChemIDplus |
| 1-(hexahydrocyclopenta(c)pyrrol-2(1H)-yl)-3-(p-tolylsulfonyl)urea | ChemIDplus |
| Gliclazide | ChemIDplus |
| Glimicron | ChemIDplus |
| J3.151H | ChEMBL |
| NSC-758673 | ChEMBL |
| Brand Names | Source |
|---|---|
| Bilxona | ChEMBL |
| Dacadis mr | ChEMBL |
| Diaglyk | ChEMBL |
| Diamicron | ChEMBL |
| Diamicron mr | ChEMBL |
| Edicil | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1299 | DrugCentral |
| D01599 | KEGG DRUG |
| DB01120 | DrugBank |
| Gliclazide | Wikipedia |
| HMDB0015252 | HMDB |
| LSM-5096 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1657836 | Reaxys |
| CAS:21187-98-4 | ChemIDplus |
| CAS:21187-98-4 | KEGG DRUG |
| Citations |
|---|