EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31649 - teprenone
| Formula | C23H38O |
| Net Charge | 0 |
| Average Mass | 330.556 |
| Monoisotopic Mass | 330.29227 |
| SMILES | [H]C(CCC(C)=O)=C(C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H38O/c1-19(2)11-7-12-20(3)13-8-14-21(4)15-9-16-22(5)17-10-18-23(6)24/h11,13,15,17H,7-10,12,14,16,18H2,1-6H3/b20-13+,21-15+,22-17? |
| InChIKey | HUCXKZBETONXFO-AJDZVAQLSA-N |
| Roles Classification |
|---|
| Biological Role: | Hsp70 inducer Any inducer of heat shock protein 70. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| teprenone (CHEBI:31649) has part geranylgeranyl group (CHEBI:24231) |
| teprenone (CHEBI:31649) has role anti-ulcer drug (CHEBI:49201) |
| teprenone (CHEBI:31649) has role cardioprotective agent (CHEBI:77307) |
| teprenone (CHEBI:31649) has role hepatoprotective agent (CHEBI:62868) |
| teprenone (CHEBI:31649) has role Hsp70 inducer (CHEBI:78606) |
| teprenone (CHEBI:31649) has role nephroprotective agent (CHEBI:76595) |
| teprenone (CHEBI:31649) has role neuroprotective agent (CHEBI:63726) |
| teprenone (CHEBI:31649) is a methyl ketone (CHEBI:51867) |
| teprenone (CHEBI:31649) is a terpene ketone (CHEBI:26872) |
| IUPAC Name |
|---|
| (9E,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one |
| INNs | Source |
|---|---|
| teprenona | ChemIDplus |
| teprenone | KEGG DRUG |
| téprénone | WHO MedNet |
| teprenonum | ChemIDplus |
| Synonym | Source |
|---|---|
| Geranylgeranylacetone | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Selbex | KEGG DRUG |
| Citations |
|---|