EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O2 |
| Net Charge | 0 |
| Average Mass | 400.647 |
| Monoisotopic Mass | 400.33413 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C27H44O2/c1-22(2)12-8-14-24(5)16-10-17-25(6)18-11-19-27(28)29-21-20-26(7)15-9-13-23(3)4/h12-13,16,18,20H,8-11,14-15,17,19,21H2,1-7H3/b24-16+,25-18+,26-20+ |
| InChIKey | ZPACYDRSPFRDHO-ROBAGEODSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gefarnate (CHEBI:31646) has role anti-ulcer drug (CHEBI:49201) |
| Gefarnate (CHEBI:31646) has role cardiovascular drug (CHEBI:35554) |
| Gefarnate (CHEBI:31646) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| gefarnato | WHO MedNet |
| Synonyms | Source |
|---|---|
| DA 688 | ChEMBL |
| DA-688 | ChEMBL |
| dixnalate | DrugCentral |
| Gefanil | ChEMBL |
| Gefarnate | KEGG COMPOUND |
| gefarnyl | DrugCentral |
| Citations |
|---|