EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13F2N6O4P |
| Net Charge | 0 |
| Average Mass | 386.255 |
| Monoisotopic Mass | 386.07040 |
| SMILES | O=P(O)(O)OC(Cn1cncn1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H13F2N6O4P/c14-10-1-2-11(12(15)3-10)13(25-26(22,23)24,4-20-8-16-6-18-20)5-21-9-17-7-19-21/h1-3,6-9H,4-5H2,(H2,22,23,24) |
| InChIKey | GHJWNRRCRIGGIO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fosfluconazole (CHEBI:31634) has functional parent fluconazole (CHEBI:46081) |
| Fosfluconazole (CHEBI:31634) has role prodrug (CHEBI:50266) |
| Fosfluconazole (CHEBI:31634) is a conazole antifungal drug (CHEBI:87071) |
| Fosfluconazole (CHEBI:31634) is a triazole antifungal drug (CHEBI:87101) |
| Fosfluconazole (CHEBI:31634) is a triazoles (CHEBI:35727) |
| Synonyms | Source |
|---|---|
| Fosfluconazole | KEGG COMPOUND |
| prodif | DrugCentral |