EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11) |
| InChIKey | ZGUNAGUHMKGQNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-phenylglycine (CHEBI:55484) has role human metabolite (CHEBI:77746) |
| α-phenylglycine (CHEBI:55484) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| D-α-phenylglycine (CHEBI:44962) is a α-phenylglycine (CHEBI:55484) |
| L-α-phenylglycine (CHEBI:439819) is a α-phenylglycine (CHEBI:55484) |
| IUPAC Name |
|---|
| amino(phenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 2-Amino-2-phenylacetic acid | ChemIDplus |
| 2-Phenylglycine | ChemIDplus |
| alpha-amino-alpha-Toluic acid | ChemIDplus |
| alpha-Aminobenzeneacetic acid | ChemIDplus |
| alpha-Aminophenylacetic acid | ChemIDplus |
| Amino(phenyl)acetic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002210 | HMDB |
| Citations |
|---|