EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36F2O6 |
| Net Charge | 0 |
| Average Mass | 494.575 |
| Monoisotopic Mass | 494.24800 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)COC(=O)C(C)(C)C)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C27H36F2O6/c1-14-9-16-17-11-19(28)18-10-15(30)7-8-24(18,5)26(17,29)20(31)12-25(16,6)27(14,34)21(32)13-35-22(33)23(2,3)4/h7-8,10,14,16-17,19-20,31,34H,9,11-13H2,1-6H3/t14-,16+,17+,19+,20+,24+,25+,26+,27+/m1/s1 |
| InChIKey | JWRMHDSINXPDHB-OJAGFMMFSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flumethasone pivalate (CHEBI:31620) has functional parent flumethasone (CHEBI:34764) |
| flumethasone pivalate (CHEBI:31620) has role anti-inflammatory drug (CHEBI:35472) |
| flumethasone pivalate (CHEBI:31620) has role antipruritic drug (CHEBI:59683) |
| flumethasone pivalate (CHEBI:31620) is a 11β-hydroxy steroid (CHEBI:35346) |
| flumethasone pivalate (CHEBI:31620) is a 17α-hydroxy steroid (CHEBI:35342) |
| flumethasone pivalate (CHEBI:31620) is a 20-oxo steroid (CHEBI:36885) |
| flumethasone pivalate (CHEBI:31620) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| flumethasone pivalate (CHEBI:31620) is a fluorinated steroid (CHEBI:50830) |
| flumethasone pivalate (CHEBI:31620) is a glucocorticoid (CHEBI:24261) |
| flumethasone pivalate (CHEBI:31620) is a pivalate ester (CHEBI:50784) |
| flumethasone pivalate (CHEBI:31620) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| 6α,9-difluoro-11β,17-dihydroxy-16α-methyl-3,20-dioxopregna-1,4-dien-21-yl 2,2-dimethylpropanoate |
| Synonym | Source |
|---|---|
| Flumetasone pivalate | KEGG DRUG |