EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O6 |
| Net Charge | 0 |
| Average Mass | 298.250 |
| Monoisotopic Mass | 298.04774 |
| SMILES | COC1=CC(=O)C(c2coc3cc(O)ccc3c2=O)=CC1=O |
| InChI | InChI=1S/C16H10O6/c1-21-15-6-12(18)10(5-13(15)19)11-7-22-14-4-8(17)2-3-9(14)16(11)20/h2-7,17H,1H3 |
| InChIKey | GCAIEHBYLQNGAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bowdichione (CHEBI:3162) has role anti-inflammatory agent (CHEBI:67079) |
| bowdichione (CHEBI:3162) has role antineoplastic agent (CHEBI:35610) |
| bowdichione (CHEBI:3162) has role metabolite (CHEBI:25212) |
| bowdichione (CHEBI:3162) is a 1,4-benzoquinones (CHEBI:132124) |
| bowdichione (CHEBI:3162) is a hydroxyisoflavone (CHEBI:38755) |
| bowdichione (CHEBI:3162) is a methoxyisoflavone (CHEBI:38756) |
| bowdichione (CHEBI:3162) is a oxoisoflavone (CHEBI:50278) |
| IUPAC Name |
|---|
| 2-(7-hydroxy-4-oxo-4H-chromen-3-yl)-5-methoxybenzo-1,4-quinone |
| Synonym | Source |
|---|---|
| Bowdichione | KEGG COMPOUND |
| Citations |
|---|