EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13FN5O7P |
| Net Charge | 0 |
| Average Mass | 365.214 |
| Monoisotopic Mass | 365.05366 |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H13FN5O7P/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(18)5(17)3(23-9)1-22-24(19,20)21/h2-3,5-6,9,17-18H,1H2,(H2,12,14,15)(H2,19,20,21)/t3-,5-,6+,9-/m1/s1 |
| InChIKey | GIUYCYHIANZCFB-FJFJXFQQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fludarabine phosphate (CHEBI:63599) has functional parent 2-fluoroadenine (CHEBI:72457) |
| fludarabine phosphate (CHEBI:63599) has role antimetabolite (CHEBI:35221) |
| fludarabine phosphate (CHEBI:63599) has role antineoplastic agent (CHEBI:35610) |
| fludarabine phosphate (CHEBI:63599) has role antiviral agent (CHEBI:22587) |
| fludarabine phosphate (CHEBI:63599) has role DNA synthesis inhibitor (CHEBI:59517) |
| fludarabine phosphate (CHEBI:63599) has role immunosuppressive agent (CHEBI:35705) |
| fludarabine phosphate (CHEBI:63599) has role prodrug (CHEBI:50266) |
| fludarabine phosphate (CHEBI:63599) is a nucleoside analogue (CHEBI:60783) |
| fludarabine phosphate (CHEBI:63599) is a organofluorine compound (CHEBI:37143) |
| fludarabine phosphate (CHEBI:63599) is a purine arabinonucleoside monophosphate (CHEBI:37514) |
| IUPAC Name |
|---|
| 2-fluoro-9-(5-O-phosphono-β-D-arabinofuranosyl)-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 2F-ara-AMP | ChEBI |
| 2-Fluoroadenine arabinoside 5'-monophosphate | ChemIDplus |
| 2-Fluoro-ARA AMP | ChemIDplus |
| 9-beta-Arabinofuranosyl-2-fluoroadenine-5'-phosphate | ChemIDplus |
| 9-beta-D-Arabinofuranosyl-2-fluoroadenine 5'-(dihydrogen phosphate) | ChemIDplus |
| 9-beta-D-Arabinofuranosyl-2-fluoroadenine 5'-monophosphate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Fludara | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1189 | DrugCentral |
| D01907 | KEGG DRUG |
| DB01073 | DrugBank |
| Fludarabine | Wikipedia |
| WO2010046917 | Patent |
| WO2010133629 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8167686 | Reaxys |
| CAS:75607-67-9 | KEGG DRUG |
| CAS:75607-67-9 | ChemIDplus |
| Citations |
|---|