EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36N2O18 |
| Net Charge | 0 |
| Average Mass | 712.614 |
| Monoisotopic Mass | 712.19631 |
| SMILES | O=C(O)C1=C/C(=C/C=[N+]2/c3cc(O)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3C[C@H]2C(=O)[O-])C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C30H36N2O18/c33-8-18-20(36)22(38)24(40)29(48-18)50-25-23(39)21(37)19(9-34)49-30(25)47-17-6-11-5-15(28(45)46)32(14(11)7-16(17)35)2-1-10-3-12(26(41)42)31-13(4-10)27(43)44/h1-3,6-7,13,15,18-25,29-30,33-34,36-40H,4-5,8-9H2,(H4,35,41,42,43,44,45,46)/t13-,15-,18+,19+,20+,21+,22-,23-,24+,25+,29-,30+/m0/s1 |
| InChIKey | JFSHCYUNIKQIPE-XAZCMKEVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bougainvillein-r-I (CHEBI:3161) has functional parent betanidin (CHEBI:3079) |
| Bougainvillein-r-I (CHEBI:3161) is a betalain (CHEBI:22861) |
| Bougainvillein-r-I (CHEBI:3161) is a sophoroside (CHEBI:145470) |
| Synonym | Source |
|---|---|
| Bougainvillein-r-I | KEGG COMPOUND |