EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31607 - Ferrous fumarate
| Formula | C4H2O4.Fe |
| Net Charge | 0 |
| Average Mass | 169.901 |
| Monoisotopic Mass | 169.93025 |
| SMILES | O=C([O-])/C=C/C(=O)[O-].[Fe+2] |
| InChI | InChI=1S/C4H4O4.Fe/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2/b2-1+; |
| InChIKey | PMVSDNDAUGGCCE-TYYBGVCCSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ferrous fumarate (CHEBI:31607) has role anti-anaemic agent (CHEBI:75835) |
| Ferrous fumarate (CHEBI:31607) has role anti-HIV agent (CHEBI:64946) |
| Ferrous fumarate (CHEBI:31607) has role antibacterial agent (CHEBI:33282) |
| Ferrous fumarate (CHEBI:31607) is a dicarboxylic acid (CHEBI:35692) |
| Synonyms | Source |
|---|---|
| Cpiron | ChEMBL |
| Erco-fer | ChEMBL |
| Ercoferro | ChEMBL |
| Ferrofume | ChEMBL |
| Ferrosi fumaras | ChEMBL |
| Ferrous fumarate | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Ferrous fumarate component of lo minastrin fe | ChEMBL |
| Ferrous fumarate component of minastrin 24 fe | ChEMBL |
| Ferrous fumarate component of norquest fe | ChEMBL |
| Fersaday | ChEMBL |
| Fersamal | ChEMBL |
| Galfer | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01194 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:141-01-5 | KEGG COMPOUND |