EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O3 |
| Net Charge | 0 |
| Average Mass | 254.285 |
| Monoisotopic Mass | 254.09429 |
| SMILES | O=C(O)CCC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19) |
| InChIKey | ZPAKPRAICRBAOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenbufen (CHEBI:31599) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| fenbufen (CHEBI:31599) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| fenbufen (CHEBI:31599) is a biphenyls (CHEBI:22888) |
| IUPAC Name |
|---|
| 4-[1,1'-biphenyl-4-yl]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| Fenbufen | KEGG DRUG |
| 3-(4-biphenylylcarbonyl)propionic acid | ChemIDplus |
| 3-(4-phenylbenzoyl)propionic acid | ChemIDplus |
| γ-oxo(1,1'-biphenyl)-4-butanoic acid | ChemIDplus |
| 4-(4-biphenylyl)-4-oxobutyric acid | ChemIDplus |
| 4-biphenyl-4-yl-4-oxobutanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2378560 | Beilstein |
| CAS:36330-85-5 | ChemIDplus |