EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O3S |
| Net Charge | 0 |
| Average Mass | 316.382 |
| Monoisotopic Mass | 316.08816 |
| SMILES | Cc1nc(-c2ccc(OCC(C)C)c(C#N)c2)sc1C(=O)O |
| InChI | InChI=1S/C16H16N2O3S/c1-9(2)8-21-13-5-4-11(6-12(13)7-17)15-18-10(3)14(22-15)16(19)20/h4-6,9H,8H2,1-3H3,(H,19,20) |
| InChIKey | BQSJTQLCZDPROO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.17.3.2 (xanthine oxidase) inhibitor An EC 1.17.3.* (oxidoreductase acting on CH or CH2 with oxygen as acceptor) inhibitor that interferes with the action of xanthine oxidase (EC 1.17.3.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| febuxostat (CHEBI:31596) has role EC 1.17.3.2 (xanthine oxidase) inhibitor (CHEBI:35634) |
| febuxostat (CHEBI:31596) is a 1,3-thiazolemonocarboxylic acid (CHEBI:48652) |
| febuxostat (CHEBI:31596) is a aromatic ether (CHEBI:35618) |
| febuxostat (CHEBI:31596) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| INNs | Source |
|---|---|
| febuxostat | WHO MedNet |
| fébuxostat | WHO MedNet |
| febuxostatum | WHO MedNet |
| febuxostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| TMX 67 | ChemIDplus |
| 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid | DrugBank |
| TMX-67 | ChemIDplus |
| TEI 6720 | ChemIDplus |
| TEI-6720 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Adenuric | DrugCentral |
| Uloric | KEGG DRUG |
| Feburic | KEGG DRUG |
| Febuday | ChEBI |
| Goturic | ChEBI |
| Donifoxate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:144060-53-7 | KEGG COMPOUND |
| CAS:144060-53-7 | ChemIDplus |
| Citations |
|---|