EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O3S |
| Net Charge | 0 |
| Average Mass | 316.382 |
| Monoisotopic Mass | 316.08816 |
| SMILES | Cc1nc(-c2ccc(OCC(C)C)c(C#N)c2)sc1C(=O)O |
| InChI | InChI=1S/C16H16N2O3S/c1-9(2)8-21-13-5-4-11(6-12(13)7-17)15-18-10(3)14(22-15)16(19)20/h4-6,9H,8H2,1-3H3,(H,19,20) |
| InChIKey | BQSJTQLCZDPROO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.17.3.2 (xanthine oxidase) inhibitor An EC 1.17.3.* (oxidoreductase acting on CH or CH2 with oxygen as acceptor) inhibitor that interferes with the action of xanthine oxidase (EC 1.17.3.2). |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| febuxostat (CHEBI:31596) has role antihypertensive agent (CHEBI:35674) |
| febuxostat (CHEBI:31596) has role cardiovascular drug (CHEBI:35554) |
| febuxostat (CHEBI:31596) has role EC 1.17.3.2 (xanthine oxidase) inhibitor (CHEBI:35634) |
| febuxostat (CHEBI:31596) has role gout suppressant (CHEBI:35845) |
| febuxostat (CHEBI:31596) has role renoprotective agent (CHEBI:231911) |
| febuxostat (CHEBI:31596) is a 1,3-thiazolemonocarboxylic acid (CHEBI:48652) |
| febuxostat (CHEBI:31596) is a aromatic ether (CHEBI:35618) |
| febuxostat (CHEBI:31596) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| INNs | Source |
|---|---|
| febuxostat | WHO MedNet |
| febuxostat | WHO MedNet |
| fébuxostat | WHO MedNet |
| febuxostatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid | DrugBank |
| NSC-758874 | ChEMBL |
| TEI 6720 | ChemIDplus |
| TEI-6720 | ChemIDplus |
| TMX 67 | ChemIDplus |
| TMX-67 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Adenuric | DrugCentral |
| Donifoxate | ChEBI |
| Febuday | ChEBI |
| Feburic | KEGG DRUG |
| Feburic | ChEBI |
| Febuxostat krka | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:144060-53-7 | ChemIDplus |
| CAS:144060-53-7 | KEGG COMPOUND |
| Citations |
|---|