EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15ClN4S |
| Net Charge | 0 |
| Average Mass | 342.855 |
| Monoisotopic Mass | 342.07060 |
| SMILES | CCc1cc2c(s1)-n1c(C)nnc1CN=C2c1ccccc1Cl |
| InChI | InChI=1S/C17H15ClN4S/c1-3-11-8-13-16(12-6-4-5-7-14(12)18)19-9-15-21-20-10(2)22(15)17(13)23-11/h4-8H,3,9H2,1-2H3 |
| InChIKey | VMZUTJCNQWMAGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Etizolam (CHEBI:31583) has role anxiolytic drug (CHEBI:35474) |
| Etizolam (CHEBI:31583) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| AHR-3219 | DrugCentral |
| DEA NO. 2780 | ChEMBL |
| depas | DrugCentral |
| Etizolam | KEGG COMPOUND |
| Sedekopan | ChEMBL |
| Y-7131 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1102 | DrugCentral |
| D01514 | KEGG DRUG |
| HMDB0041890 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:40054-69-1 | KEGG COMPOUND |
| Citations |
|---|