EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O |
| Net Charge | 0 |
| Average Mass | 288.475 |
| Monoisotopic Mass | 288.24532 |
| SMILES | [H][C@@]12CCC3=CCCC[C@]3([H])[C@@]1([H])CC[C@]1(C)[C@](O)(CC)CC[C@@]21[H] |
| InChI | InChI=1S/C20H32O/c1-3-20(21)13-11-18-17-9-8-14-6-4-5-7-15(14)16(17)10-12-19(18,20)2/h6,15-18,21H,3-5,7-13H2,1-2H3/t15-,16+,17+,18-,19-,20-/m0/s1 |
| InChIKey | AOXRBFRFYPMWLR-XGXHKTLJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylestrenol (CHEBI:31578) has role anabolic agent (CHEBI:36413) |
| ethylestrenol (CHEBI:31578) is a 17β-hydroxy steroid (CHEBI:35343) |
| ethylestrenol (CHEBI:31578) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (17α)-19-norpregn-4-en-17-ol |
| INNs | Source |
|---|---|
| etilestrenol | ChemIDplus |
| ethylestrenol | ChemIDplus |
| ethylestrenolum | ChemIDplus |
| éthylestrénol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 17α-ethylestr-4-en-17β-ol | ChemIDplus |
| 17β-hydroxy-17α-ethyl-19-nor-4-androstene | ChemIDplus |
| 17α-ethyl-17β-hydroxy-4-estrene | ChemIDplus |
| 19-nor-17α-pregn-4-en-17β-ol | ChemIDplus |
| ethylnandrol | KEGG DRUG |
| Brand Names | Source |
|---|---|
| Maxibolin | ChemIDplus |
| Neodurabolin | ChemIDplus |
| Orabolin | KEGG DRUG |
| Orgabolin | ChemIDplus |
| Orgaboral | ChemIDplus |
| Duraboral | ChemIDplus |
| Citations |
|---|