EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31575 - ethylparaben
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | CCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6,10H,2H2,1H3 |
| InChIKey | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aeschynanthus bracteatus (ncbitaxon:175969) | - | PubMed (18590922) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Application: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylparaben (CHEBI:31575) has role antifungal agent (CHEBI:35718) |
| ethylparaben (CHEBI:31575) has role antimicrobial food preservative (CHEBI:65256) |
| ethylparaben (CHEBI:31575) has role phytoestrogen (CHEBI:76989) |
| ethylparaben (CHEBI:31575) has role plant metabolite (CHEBI:76924) |
| ethylparaben (CHEBI:31575) is a ethyl ester (CHEBI:23990) |
| ethylparaben (CHEBI:31575) is a paraben (CHEBI:85122) |
| IUPAC Name |
|---|
| ethyl 4-hydroxybenzoate |
| Synonyms | Source |
|---|---|
| Ethyl parahydroxybenzoate | KEGG DRUG |
| p-Oxybenzoesaeureaethylester | ChemIDplus |
| E214 | ChEBI |
| p-hydroxybenzoic acid ethyl ester | ChemIDplus |
| ethyl paraben | ChemIDplus |
| 4-hydroxybenzoic acid ethyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01647 | KEGG DRUG |
| E4B | PDBeChem |
| HMDB0032573 | HMDB |
| C00033837 | KNApSAcK |
| Ethylparaben | Wikipedia |
| 4773 | DrugCentral |
| Citations |
|---|