EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14ClFN2O3 |
| Net Charge | 0 |
| Average Mass | 360.772 |
| Monoisotopic Mass | 360.06770 |
| SMILES | CCOC(=O)C1N=C(c2ccccc2F)c2cc(Cl)ccc2NC1=O |
| InChI | InChI=1S/C18H14ClFN2O3/c1-2-25-18(24)16-17(23)21-14-8-7-10(19)9-12(14)15(22-16)11-5-3-4-6-13(11)20/h3-9,16H,2H2,1H3,(H,21,23) |
| InChIKey | CUCHJCMWNFEYOM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl loflazepate (CHEBI:31573) has role anxiolytic drug (CHEBI:35474) |
| Ethyl loflazepate (CHEBI:31573) is a organic molecular entity (CHEBI:50860) |
| INNs | Source |
|---|---|
| loflazepate d'ethyle | WHO MedNet |
| loflazepato de etilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| CM 6912 | DrugCentral |
| CM-6912 | DrugCentral |
| CM6912 | DrugCentral |
| ethyl flucozepate | DrugCentral |
| Ethyl loflazepate | KEGG COMPOUND |
| meilax | DrugCentral |
| Citations |
|---|