EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31572 - ethyl linoleate
| Formula | C20H36O2 |
| Net Charge | 0 |
| Average Mass | 308.506 |
| Monoisotopic Mass | 308.27153 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C20H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h8-9,11-12H,3-7,10,13-19H2,1-2H3/b9-8-,12-11- |
| InChIKey | FMMOOAYVCKXGMF-MURFETPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dioscorea polystachya (ncbitaxon:55575) | bark (BTO:0001301) | PubMed (24689699) | |
| Allium sativum (ncbitaxon:4682) | bulb (BTO:0000159) | PubMed (24508058) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl linoleate (CHEBI:31572) has functional parent linoleic acid (CHEBI:17351) |
| ethyl linoleate (CHEBI:31572) has role anti-inflammatory agent (CHEBI:67079) |
| ethyl linoleate (CHEBI:31572) has role plant metabolite (CHEBI:76924) |
| ethyl linoleate (CHEBI:31572) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| IUPAC Name |
|---|
| ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| ethyl (9Z,12Z)-octadecadienoate | ChEBI |
| Linoleic acid ethyl ester | ChemIDplus |
| Ethyl cis,cis-9,12-octadecadienoate | ChemIDplus |
| 9,12-Octadecadienoic acid ethyl ester | ChemIDplus |
| ethyl (Z,Z)-9,12-octadecadienoate | NIST Chemistry WebBook |
| Citations |
|---|