EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O3 |
| Net Charge | 0 |
| Average Mass | 356.506 |
| Monoisotopic Mass | 356.23514 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](OC(=O)CCCC)CC[C@@]21[H] |
| InChI | InChI=1S/C23H32O3/c1-3-4-5-22(25)26-21-11-10-20-19-8-6-15-14-16(24)7-9-17(15)18(19)12-13-23(20,21)2/h7,9,14,18-21,24H,3-6,8,10-13H2,1-2H3/t18-,19-,20+,21+,23+/m1/s1 |
| InChIKey | RSEPBGGWRJCQGY-RBRWEJTLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Estradiol valerate (CHEBI:31561) is a steroid ester (CHEBI:47880) |
| INNs | Source |
|---|---|
| valerate d'estradiol | WHO MedNet |
| valerato de estradiol | WHO MedNet |
| Synonyms | Source |
|---|---|
| .beta.-estradiol 17-valerate | ChEMBL |
| Estradiol 17-valerate | ChEMBL |
| Estradiol valerate | KEGG COMPOUND |
| estraval | DrugCentral |
| femogex | DrugCentral |
| neofollin | DrugCentral |
| Brand Names | Source |
|---|---|
| Climaval | ChEMBL |
| Deladumone | ChEMBL |
| Delestrogen | ChEMBL |
| Estradiol valerate component of ditate-ds | ChEMBL |
| Estradiol valerate component of natazia | ChEMBL |
| Femtab | ChEMBL |
| Citations |
|---|