EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H75NO16 |
| Net Charge | 0 |
| Average Mass | 862.064 |
| Monoisotopic Mass | 861.50859 |
| SMILES | CCOC(=O)CCC(=O)O[C@H]1[C@H](O[C@@H]2[C@@H](C)[C@H](O[C@H]3C[C@@](C)(OC)[C@@H](O)[C@H](C)O3)[C@@H](C)C(=O)O[C@H](CC)[C@@](C)(O)[C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@]2(C)O)O[C@H](C)C[C@@H]1N(C)C |
| InChI | InChI=1S/C43H75NO16/c1-15-29-43(11,52)36(48)24(5)33(47)22(3)20-41(9,51)38(25(6)34(26(7)39(50)57-29)59-32-21-42(10,53-14)37(49)27(8)56-32)60-40-35(28(44(12)13)19-23(4)55-40)58-31(46)18-17-30(45)54-16-2/h22-29,32,34-38,40,48-49,51-52H,15-21H2,1-14H3/t22-,23-,24+,25+,26-,27+,28+,29-,32+,34+,35-,36-,37+,38-,40+,41-,42-,43-/m1/s1 |
| InChIKey | NSYZCCDSJNWWJL-YXOIYICCSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythromycin ethylsuccinate (CHEBI:31555) has functional parent erythromycin A (CHEBI:42355) |
| erythromycin ethylsuccinate (CHEBI:31555) is a cyclic ketone (CHEBI:3992) |
| erythromycin ethylsuccinate (CHEBI:31555) is a erythromycin derivative (CHEBI:48924) |
| erythromycin ethylsuccinate (CHEBI:31555) is a ethyl ester (CHEBI:23990) |
| erythromycin ethylsuccinate (CHEBI:31555) is a succinate ester (CHEBI:36181) |
| IUPAC Name |
|---|
| (2S,3R,4S,6R)-4-(dimethylamino)-2-{[(3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-14-ethyl-7,12,13-trihydroxy-4-{[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyltetrahydro-2H-pyran-2-yl]oxy}-3,5,7,9,11,13-hexamethyl-2,10-dioxo-1-oxacyclotetradecan-6-yl]oxy}-6-methyltetrahydro-2H-pyran-3-yl ethyl butanedioate |
| Synonyms | Source |
|---|---|
| erythrocin ethyl succinate | ChemIDplus |
| erythromycin 2'-(ethyl butanedioate) | ChemIDplus |
| erythromycin 2'-(ethyl succinate) | ChemIDplus |
| erythromycin ethyl succinate | ChemIDplus |
| erythromycin ethylsuccinate | ChemIDplus |
| erythromycin mono(ethyl succinate) | ChemIDplus |
| Brand Names | Source |
|---|---|
| E.E.S | ChemIDplus |
| EES | ChemIDplus |
| E.E.S 200 | ChemIDplus |
| E.E.S 400 | ChemIDplus |
| E-Mycin | ChemIDplus |
| E-Mycin E | ChemIDplus |
| Citations |
|---|