EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N3O2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 441.484 |
| Monoisotopic Mass | 441.18999 |
| SMILES | O=C(O)/C=C\C(=O)O.[H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@@H](C)CO)CN2C |
| InChI | InChI=1S/C19H23N3O2.C4H4O4/c1-11(10-23)21-19(24)13-6-15-14-4-3-5-16-18(14)12(8-20-16)7-17(15)22(2)9-13;5-3(6)1-2-4(7)8/h3-6,8,11,13,17,20,23H,7,9-10H2,1-2H3,(H,21,24);1-2H,(H,5,6)(H,7,8)/b;2-1-/t11-,13+,17+;/m0./s1 |
| InChIKey | YREISLCRUMOYAY-IIPCNOPRSA-N |
| Roles Classification |
|---|
| Applications: | oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). diagnostic agent A substance administered to aid diagnosis of a disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergometrine maleate (CHEBI:31554) has part ergometrine (CHEBI:4822) |
| ergometrine maleate (CHEBI:31554) has role diagnostic agent (CHEBI:33295) |
| ergometrine maleate (CHEBI:31554) has role oxytocic (CHEBI:36063) |
| ergometrine maleate (CHEBI:31554) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| N-[(2S)-1-hydroxypropan-2-yl]-6-methyl-9,10-didehydroergoline-8β-carboxamide (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| ergonovine maleate | KEGG DRUG |
| ergometrine maleate (1:1) | ChemIDplus |
| ergometrin acid maleate | ChemIDplus |
| ergonovine hydrogen maleate | ChemIDplus |
| ergometrine hydrogen maleate | ChemIDplus |
| 9,10-didehydro-N-((S)-2-hydroxy-1-methylethyl)-6-methylergoline-8β-carboxamide maleate (1:1) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01163 | KEGG DRUG |
| DB01253 | DrugBank |
| HMDB0015383 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3855736 | Reaxys |
| CAS:129-51-1 | KEGG DRUG |
| CAS:129-51-1 | ChemIDplus |