EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N3O2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 441.484 |
| Monoisotopic Mass | 441.18999 |
| SMILES | O=C(O)/C=C\C(=O)O.[H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@@H](C)CO)CN2C |
| InChI | InChI=1S/C19H23N3O2.C4H4O4/c1-11(10-23)21-19(24)13-6-15-14-4-3-5-16-18(14)12(8-20-16)7-17(15)22(2)9-13;5-3(6)1-2-4(7)8/h3-6,8,11,13,17,20,23H,7,9-10H2,1-2H3,(H,21,24);1-2H,(H,5,6)(H,7,8)/b;2-1-/t11-,13+,17+;/m0./s1 |
| InChIKey | YREISLCRUMOYAY-IIPCNOPRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). diagnostic agent A substance administered to aid diagnosis of a disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergometrine maleate (CHEBI:31554) has part ergometrine (CHEBI:4822) |
| ergometrine maleate (CHEBI:31554) has role diagnostic agent (CHEBI:33295) |
| ergometrine maleate (CHEBI:31554) has role oxytocic (CHEBI:36063) |
| ergometrine maleate (CHEBI:31554) is a ergoline alkaloid (CHEBI:60529) |
| ergometrine maleate (CHEBI:31554) is a maleate salt (CHEBI:50221) |
| ergometrine maleate (CHEBI:31554) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[(2S)-1-hydroxypropan-2-yl]-6-methyl-9,10-didehydroergoline-8β-carboxamide (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 9,10-didehydro-N-((S)-2-hydroxy-1-methylethyl)-6-methylergoline-8β-carboxamide maleate (1:1) | ChemIDplus |
| Cornocentin | ChEMBL |
| ergometrin acid maleate | ChemIDplus |
| ergometrine hydrogen maleate | ChemIDplus |
| ergometrine maleate (1:1) | ChemIDplus |
| Ergometrini hydrogenomaleas | ChEMBL |
| Brand Names | Source |
|---|---|
| Ergotrate | ChEMBL |
| Ergotrate maleate | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01163 | KEGG DRUG |
| DB01253 | DrugBank |
| HMDB0015383 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3855736 | Reaxys |
| CAS:129-51-1 | KEGG DRUG |
| CAS:129-51-1 | ChemIDplus |
| Citations |
|---|