EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N3O2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 441.484 |
| Monoisotopic Mass | 441.18999 |
| SMILES | O=C(O)/C=C\C(=O)O.[H][C@@]12Cc3cnc4cccc(c34)C1=C[C@@H](C(=O)N[C@@H](C)CO)CN2C |
| InChI | InChI=1S/C19H23N3O2.C4H4O4/c1-11(10-23)21-19(24)13-6-15-14-4-3-5-16-18(14)12(8-20-16)7-17(15)22(2)9-13;5-3(6)1-2-4(7)8/h3-6,8,11,13,17,20,23H,7,9-10H2,1-2H3,(H,21,24);1-2H,(H,5,6)(H,7,8)/b;2-1-/t11-,13+,17+;/m0./s1 |
| InChIKey | YREISLCRUMOYAY-IIPCNOPRSA-N |
| Roles Classification |
|---|
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergometrine maleate (CHEBI:31554) has part ergometrine (CHEBI:4822) |
| ergometrine maleate (CHEBI:31554) has role diagnostic agent (CHEBI:33295) |
| ergometrine maleate (CHEBI:31554) has role oxytocic (CHEBI:36063) |
| ergometrine maleate (CHEBI:31554) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| N-[(2S)-1-hydroxypropan-2-yl]-6-methyl-9,10-didehydroergoline-8β-carboxamide (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 9,10-didehydro-N-((S)-2-hydroxy-1-methylethyl)-6-methylergoline-8β-carboxamide maleate (1:1) | ChemIDplus |
| ergometrin acid maleate | ChemIDplus |
| ergometrine hydrogen maleate | ChemIDplus |
| ergometrine maleate (1:1) | ChemIDplus |
| ergonovine hydrogen maleate | ChemIDplus |
| ergonovine maleate | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01163 | KEGG DRUG |
| DB01253 | DrugBank |
| HMDB0015383 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3855736 | Reaxys |
| CAS:129-51-1 | KEGG DRUG |
| CAS:129-51-1 | ChemIDplus |