EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N2O2.2HCl |
| Net Charge | 0 |
| Average Mass | 453.454 |
| Monoisotopic Mass | 452.19973 |
| SMILES | CCOC(CN1CCN(CC(C)C(=O)c2ccccc2)CC1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C24H32N2O2.2ClH/c1-3-28-23(21-10-6-4-7-11-21)19-26-16-14-25(15-17-26)18-20(2)24(27)22-12-8-5-9-13-22;;/h4-13,20,23H,3,14-19H2,1-2H3;2*1H |
| InChIKey | BPMQVOKMMQFZGV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eprazinone hydrochloride (CHEBI:31551) has part eprazinone(2+) (CHEBI:83323) |
| eprazinone hydrochloride (CHEBI:31551) has role mucolytic (CHEBI:77034) |
| eprazinone hydrochloride (CHEBI:31551) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 1-(2-ethoxy-2-phenylethyl)-4-(2-methyl-3-oxo-3-phenylpropyl)piperazinediium dichloride |
| 3-[4-(2-ethoxy-2-phenylethyl)piperazin-1-yl]-2-methyl-1-phenylpropan-1-one dihydrochloride |
| Synonyms | Source |
|---|---|
| 1-(2-Benzoylpropyl)-2-(2-ethoxy-2-phenylethyl)piperazine dihydrochloride | ChemIDplus |
| 1-(2-Phenyl-2-ethoxy)ethyl-4-(2-benzyloxy)propylpiperazine dihydrochloride | ChemIDplus |
| 2-(4-(beta-Ethoxyphenethyl)-1-piperazinylmethyl)propiophenone dihydrochloride | ChemIDplus |
| Eprazinone dihydrochloride | ChemIDplus |
| Eprazinone HCl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Eftapan | ChemIDplus |
| Resplen | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN1602869 | Patent |
| D01106 | KEGG DRUG |
| DB08990 | DrugBank |
| Eprazinone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4625548 | Reaxys |
| CAS:10402-53-6 | KEGG DRUG |
| CAS:10402-53-6 | ChemIDplus |
| Citations |
|---|