EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39NO6S |
| Net Charge | 0 |
| Average Mass | 493.666 |
| Monoisotopic Mass | 493.24981 |
| SMILES | [H][C@@]12CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@]([H])(/C(C)=C/c3csc(C)n3)C[C@]1([H])O2 |
| InChI | InChI=1S/C26H39NO6S/c1-14-8-7-9-19-21(32-19)11-20(15(2)10-18-13-34-17(4)27-18)33-23(29)12-22(28)26(5,6)25(31)16(3)24(14)30/h10,13-14,16,19-22,24,28,30H,7-9,11-12H2,1-6H3/b15-10+/t14-,16+,19+,20-,21-,22-,24-/m0/s1 |
| InChIKey | HESCAJZNRMSMJG-KKQRBIROSA-N |
| Roles Classification |
|---|
| Biological Roles: | tubulin modulator Any substance that interacts with tubulin to inhibit or promote polymerisation of microtubules. microtubule-stabilising agent Any substance that interacts with tubulin to promote polymerisation of microtubules. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epothilone A (CHEBI:31549) has role antineoplastic agent (CHEBI:35610) |
| epothilone A (CHEBI:31549) has role metabolite (CHEBI:25212) |
| epothilone A (CHEBI:31549) has role microtubule-stabilising agent (CHEBI:61950) |
| epothilone A (CHEBI:31549) has role tubulin modulator (CHEBI:60832) |
| epothilone A (CHEBI:31549) is a epothilone (CHEBI:60831) |
| epothilone A (CHEBI:31549) is a epoxide (CHEBI:32955) |
| IUPAC Name |
|---|
| (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(1E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| Synonyms | Source |
|---|---|
| Epothilone A | KEGG COMPOUND |
| EPOTHILONE A | PDBeChem |
| (1S,7S,10R,11S,12S,16R)-7-Hydroxy-11-(S)-hydroxy-8,8,10,12-tetramethyl-3-[(E)-1-methyl-2-(2-methyl-thiazol-4-yl)-vinyl]-4,17-dioxa-bicyclo[14.1.0]heptadecane-5,9-dione | ChEMBL |
| (−)-epothilone A | ChEBI |
| Epo A | ChEBI |
| UniProt Name | Source |
|---|---|
| epothilone A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C12153 | KEGG COMPOUND |
| EP | PDBeChem |
| LMPK04000040 | LIPID MAPS |
| DE4138042 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7555910 | Reaxys |
| Citations |
|---|