EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31547 - eplerenone
| Formula | C24H30O6 |
| Net Charge | 0 |
| Average Mass | 414.498 |
| Monoisotopic Mass | 414.20424 |
| SMILES | [H][C@@]12CC[C@@]3(CCC(=O)O3)[C@@]1(C)C[C@@]1([H])O[C@@]13[C@@]2([H])[C@H](C(=O)OC)CC1=CC(=O)CC[C@@]13C |
| InChI | InChI=1S/C24H30O6/c1-21-7-4-14(25)10-13(21)11-15(20(27)28-3)19-16-5-8-23(9-6-18(26)30-23)22(16,2)12-17-24(19,21)29-17/h10,15-17,19H,4-9,11-12H2,1-3H3/t15-,16+,17-,19+,21+,22+,23-,24-/m1/s1 |
| InChIKey | JUKPWJGBANNWMW-VWBFHTRKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | aldosterone antagonist A compound which inhibits or antagonizes the biosynthesis or actions of aldosterone. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. aldosterone antagonist A compound which inhibits or antagonizes the biosynthesis or actions of aldosterone. hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eplerenone (CHEBI:31547) has parent hydride pregnane (CHEBI:8386) |
| eplerenone (CHEBI:31547) has role aldosterone antagonist (CHEBI:50844) |
| eplerenone (CHEBI:31547) has role anti-arrhythmia drug (CHEBI:38070) |
| eplerenone (CHEBI:31547) has role antihypertensive agent (CHEBI:35674) |
| eplerenone (CHEBI:31547) has role antineoplastic agent (CHEBI:35610) |
| eplerenone (CHEBI:31547) has role cardiovascular drug (CHEBI:35554) |
| eplerenone (CHEBI:31547) has role hypoglycemic agent (CHEBI:35526) |
| eplerenone (CHEBI:31547) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| eplerenone (CHEBI:31547) is a epoxy steroid (CHEBI:145217) |
| eplerenone (CHEBI:31547) is a methyl ester (CHEBI:25248) |
| eplerenone (CHEBI:31547) is a organic heteropentacyclic compound (CHEBI:38164) |
| eplerenone (CHEBI:31547) is a organic molecular entity (CHEBI:50860) |
| eplerenone (CHEBI:31547) is a oxaspiro compound (CHEBI:37948) |
| eplerenone (CHEBI:31547) is a steroid acid ester (CHEBI:47887) |
| eplerenone (CHEBI:31547) is a steroid lactone (CHEBI:26766) |
| eplerenone (CHEBI:31547) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 7α-methoxycarbonyl-3-oxo-9,11α-epoxy-17α-pregn-4-ene-21,17-carbolactone |
| INNs | Source |
|---|---|
| eplerenona | WHO MedNet |
| eplerenone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Eplerenone | KEGG COMPOUND |
| Epoxymexrenone | ChemIDplus |
| SC-66110 | ChEMBL |
| SC-6611O | ChEMBL |
| Brand Name | Source |
|---|---|
| Inspra | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1032 | DrugCentral |
| C12512 | KEGG COMPOUND |
| D01115 | KEGG DRUG |
| DB00700 | DrugBank |
| Eplerenone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:107724-20-9 | KEGG COMPOUND |
| CAS:107724-20-9 | ChemIDplus |
| Citations |
|---|