EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O6 |
| Net Charge | 0 |
| Average Mass | 414.498 |
| Monoisotopic Mass | 414.20424 |
| SMILES | [H][C@@]12CC[C@@]3(CCC(=O)O3)[C@@]1(C)C[C@@]1([H])O[C@@]13[C@@]2([H])[C@H](C(=O)OC)CC1=CC(=O)CC[C@@]13C |
| InChI | InChI=1S/C24H30O6/c1-21-7-4-14(25)10-13(21)11-15(20(27)28-3)19-16-5-8-23(9-6-18(26)30-23)22(16,2)12-17-24(19,21)29-17/h10,15-17,19H,4-9,11-12H2,1-3H3/t15-,16+,17-,19+,21+,22+,23-,24-/m1/s1 |
| InChIKey | JUKPWJGBANNWMW-VWBFHTRKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | aldosterone antagonist A compound which inhibits or antagonizes the biosynthesis or actions of aldosterone. |
| Applications: | aldosterone antagonist A compound which inhibits or antagonizes the biosynthesis or actions of aldosterone. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eplerenone (CHEBI:31547) has parent hydride pregnane (CHEBI:8386) |
| eplerenone (CHEBI:31547) has role aldosterone antagonist (CHEBI:50844) |
| eplerenone (CHEBI:31547) has role antihypertensive agent (CHEBI:35674) |
| eplerenone (CHEBI:31547) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| eplerenone (CHEBI:31547) is a epoxy steroid (CHEBI:145217) |
| eplerenone (CHEBI:31547) is a methyl ester (CHEBI:25248) |
| eplerenone (CHEBI:31547) is a organic heteropentacyclic compound (CHEBI:38164) |
| eplerenone (CHEBI:31547) is a oxaspiro compound (CHEBI:37948) |
| eplerenone (CHEBI:31547) is a steroid acid ester (CHEBI:47887) |
| eplerenone (CHEBI:31547) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 7α-methoxycarbonyl-3-oxo-9,11α-epoxy-17α-pregn-4-ene-21,17-carbolactone |
| INN | Source |
|---|---|
| eplerenone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Eplerenone | KEGG COMPOUND |
| Epoxymexrenone | ChemIDplus |
| Brand Name | Source |
|---|---|
| Inspra | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1032 | DrugCentral |
| C12512 | KEGG COMPOUND |
| D01115 | KEGG DRUG |
| DB00700 | DrugBank |
| Eplerenone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:107724-20-9 | KEGG COMPOUND |
| CAS:107724-20-9 | ChemIDplus |