EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO.HCl |
| Net Charge | 0 |
| Average Mass | 201.697 |
| Monoisotopic Mass | 201.09204 |
| SMILES | CN[C@@H](C)[C@H](O)c1ccccc1.Cl |
| InChI | InChI=1S/C10H15NO.ClH/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H/t8-,10-;/m0./s1 |
| InChIKey | BALXUFOVQVENIU-GNAZCLTHSA-N |
| Roles Classification |
|---|
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ephedrine hydrochloride (CHEBI:31541) has role anti-asthmatic agent (CHEBI:65023) |
| Ephedrine hydrochloride (CHEBI:31541) has role nasal decongestant (CHEBI:77715) |
| Ephedrine hydrochloride (CHEBI:31541) is a alkylbenzene (CHEBI:38976) |
| Synonyms | Source |
|---|---|
| (-)-ephedrine hydrochloride | ChEMBL |
| Ephedrine hydrochloride | KEGG COMPOUND |
| Ephedrine (TN) | KEGG COMPOUND |
| Ephedrini hydrochloridum | ChEMBL |
| L-ephedrine hydrochloride | ChEMBL |
| NSC-759611 | ChEMBL |
| Brand Names | Source |
|---|---|
| Amesec | ChEMBL |
| Asmapax | ChEMBL |
| Bronchipax | ChEMBL |
| C.a.m. | ChEMBL |
| Do-do | ChEMBL |
| Ephed hcl | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01386 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:50-98-6 | KEGG COMPOUND |
| Citations |
|---|