EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O6 |
| Net Charge | 0 |
| Average Mass | 400.471 |
| Monoisotopic Mass | 400.18859 |
| SMILES | COC(=O)CCC=C=CC[C@@H]1C(=O)C[C@H](O)[C@H]1/C=C/[C@H](O)COc1ccccc1 |
| InChI | InChI=1S/C23H28O6/c1-28-23(27)12-8-3-2-7-11-19-20(22(26)15-21(19)25)14-13-17(24)16-29-18-9-5-4-6-10-18/h3-7,9-10,13-14,17,19-20,22,24,26H,8,11-12,15-16H2,1H3/b14-13+/t2?,17-,19-,20-,22-/m0/s1 |
| InChIKey | PTOJVMZPWPAXER-FPXSIRDUSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enprostil (CHEBI:31538) has role anti-ulcer drug (CHEBI:49201) |
| Enprostil (CHEBI:31538) is a allenes (CHEBI:37602) |
| INN | Source |
|---|---|
| enprostilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| camleed | DrugCentral |
| Enprostil | KEGG COMPOUND |
| fundyl | DrugCentral |
| gardrin | DrugCentral |
| gardrine | DrugCentral |
| RS-84135 | DrugCentral |