EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10FN3O3S |
| Net Charge | 0 |
| Average Mass | 247.251 |
| Monoisotopic Mass | 247.04269 |
| SMILES | Nc1nc(=O)n([C@@H]2CS[C@H](CO)O2)cc1F |
| InChI | InChI=1S/C8H10FN3O3S/c9-4-1-12(8(14)11-7(4)10)5-3-16-6(2-13)15-5/h1,5-6,13H,2-3H2,(H2,10,11,14)/t5-,6+/m0/s1 |
| InChIKey | XQSPYNMVSIKCOC-NTSWFWBYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emtricitabine (CHEBI:31536) has role antiviral drug (CHEBI:36044) |
| emtricitabine (CHEBI:31536) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| emtricitabine (CHEBI:31536) is a monothioacetal (CHEBI:59793) |
| emtricitabine (CHEBI:31536) is a nucleoside analogue (CHEBI:60783) |
| emtricitabine (CHEBI:31536) is a organofluorine compound (CHEBI:37143) |
| emtricitabine (CHEBI:31536) is a pyrimidone (CHEBI:38337) |
| Incoming Relation(s) |
| Descovy (CHEBI:133007) has part emtricitabine (CHEBI:31536) |
| Genvoya (CHEBI:90922) has part emtricitabine (CHEBI:31536) |
| Odefsey (CHEBI:133010) has part emtricitabine (CHEBI:31536) |
| IUPAC Name |
|---|
| 4-amino-5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| Emtricitabine | KEGG COMPOUND |
| 4-amino-5-fluoro-1-((2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl)pyrimidin-2(1H)-one | ChEMBL |
| 4-Amino-5-fluoro-1-((2R,5S)-2-hydroxymethyl-[1,3]oxathiolan-5-yl)-1H-pyrimidin-2-one | ChEMBL |
| EMTRICITABINE | ChEMBL |
| (2R-cis)-4-amino-5-fluoro-1-(2-(hydroxymethyl)-1,3-oxathiolan-5-yl)-2(1H)-pyrimidinone | ChemIDplus |
| 5-fluoro-1-((2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl)cytosine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5908714 | Beilstein |
| CAS:143491-57-0 | KEGG COMPOUND |
| CAS:143491-57-0 | ChemIDplus |
| Citations |
|---|