EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O5 |
| Net Charge | 0 |
| Average Mass | 324.332 |
| Monoisotopic Mass | 324.09977 |
| SMILES | CCOC(=O)COc1ccc2c(=O)cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C19H16O5/c1-2-22-19(21)12-23-14-8-9-15-16(20)11-17(24-18(15)10-14)13-6-4-3-5-7-13/h3-11H,2,12H2,1H3 |
| InChIKey | ZVXBAHLOGZCFTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Efloxate (CHEBI:31531) has role cardiovascular drug (CHEBI:35554) |
| Efloxate (CHEBI:31531) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| efloxato | WHO MedNet |
| Synonyms | Source |
|---|---|
| Efloxate | KEGG COMPOUND |
| flacethyle | DrugCentral |
| NSC-758891 | ChEMBL |
| oxiflavil | DrugCentral |
| oxyflavil | DrugCentral |
| Citations |
|---|