EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O |
| Net Charge | 0 |
| Average Mass | 174.203 |
| Monoisotopic Mass | 174.07931 |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C10H10N2O/c1-8-7-10(13)12(11-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | QELUYTUMUWHWMC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edaravone (CHEBI:31530) has role antioxidant (CHEBI:22586) |
| edaravone (CHEBI:31530) has role radical scavenger (CHEBI:48578) |
| edaravone (CHEBI:31530) is a pyrazolone (CHEBI:83328) |
| IUPAC Name |
|---|
| 5-methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one |
| Synonyms | Source |
|---|---|
| 1-phenyl-3-methyl-5-oxo-2-pyrazoline | ChemIDplus |
| 2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one | NIST Chemistry WebBook |
| 3-methyl-1-phenyl-2-pyrazolin-5-one | ChemIDplus |
| 3-methyl-1-phenyl-5-pyrazolone | ChemIDplus |
| 3-methyl-1-phenylpyrazol-5-one | NIST Chemistry WebBook |
| C.I. developer 1 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Radicut | KEGG DRUG |
| Citations |
|---|