EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H39NO2 |
| Net Charge | 0 |
| Average Mass | 469.669 |
| Monoisotopic Mass | 469.29808 |
| SMILES | CC(C)(C)c1ccc(C(=O)CCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H39NO2/c1-32(2,3)28-18-16-25(17-19-28)30(34)15-10-22-33-23-20-29(21-24-33)35-31(26-11-6-4-7-12-26)27-13-8-5-9-14-27/h4-9,11-14,16-19,29,31H,10,15,20-24H2,1-3H3 |
| InChIKey | MJJALKDDGIKVBE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ebastine (CHEBI:31528) has role antispasmodic drug (CHEBI:53784) |
| Ebastine (CHEBI:31528) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| ebastina | WHO MedNet |
| Synonyms | Source |
|---|---|
| bastel | DrugCentral |
| ebastel | DrugCentral |
| ebastin | DrugCentral |
| Ebastine | KEGG COMPOUND |
| erostin | DrugCentral |
| kestine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 977 | DrugCentral |
| D01478 | KEGG DRUG |
| HMDB0060159 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:90729-43-4 | KEGG COMPOUND |
| Citations |
|---|