EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO5 |
| Net Charge | 0 |
| Average Mass | 213.189 |
| Monoisotopic Mass | 213.06372 |
| SMILES | N[C@H](C(=O)O)[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO5/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4/h1-3,7-8,11-13H,10H2,(H,14,15)/t7-,8+/m0/s1 |
| InChIKey | QXWYKJLNLSIPIN-JGVFFNPUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| droxidopa (CHEBI:31524) has role antihypertensive agent (CHEBI:35674) |
| droxidopa (CHEBI:31524) has role prodrug (CHEBI:50266) |
| droxidopa (CHEBI:31524) has role vasoconstrictor agent (CHEBI:50514) |
| droxidopa (CHEBI:31524) is a L-tyrosine derivative (CHEBI:27177) |
| droxidopa (CHEBI:31524) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| (βR)-β,3-dihydroxy-L-tyrosine |
| INNs | Source |
|---|---|
| droxidopa | WHO MedNet |
| droxidopa | WHO MedNet |
| droxidopa | KEGG DRUG |
| droxidopum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-(2S,3R)-2-amino-3-hydroxy-3-(3,4-dihydroxyphenyl)propanoic acid | ChEBI |
| (2S,3R)-3,4-dihydroxy-phenylserine | ChEBI |
| Droxydopa | HMDB |
| L-Dihydroxyphenylserine | DrugBank |
| L-DOPS | DrugBank |
| L-threo-dihydroxyphenylserine | DrugBank |
| Brand Names | Source |
|---|---|
| Dops | KEGG DRUG |
| Northera | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 971 | DrugCentral |
| D01277 | KEGG DRUG |
| DB06262 | DrugBank |
| Droxidopa | Wikipedia |
| HMDB0015627 | HMDB |
| JP2005247828 | Patent |
| NZ579368 | Patent |
| US2008221170 | Patent |
| US2012010293 | Patent |
| US2013253061 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7112431 | Reaxys |
| CAS:23651-95-8 | ChemIDplus |
| CAS:23651-95-8 | KEGG DRUG |
| Citations |
|---|