EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO5 |
| Net Charge | 0 |
| Average Mass | 213.189 |
| Monoisotopic Mass | 213.06372 |
| SMILES | N[C@H](C(=O)O)[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO5/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4/h1-3,7-8,11-13H,10H2,(H,14,15)/t7-,8+/m0/s1 |
| InChIKey | QXWYKJLNLSIPIN-JGVFFNPUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. vasoconstrictor agent Drug used to cause constriction of the blood vessels. antiparkinson drug A drug used in the treatment of Parkinson's disease. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| droxidopa (CHEBI:31524) has role antihypertensive agent (CHEBI:35674) |
| droxidopa (CHEBI:31524) has role antiparkinson drug (CHEBI:48407) |
| droxidopa (CHEBI:31524) has role cardiovascular drug (CHEBI:35554) |
| droxidopa (CHEBI:31524) has role prodrug (CHEBI:50266) |
| droxidopa (CHEBI:31524) has role vasoconstrictor agent (CHEBI:50514) |
| droxidopa (CHEBI:31524) is a L-tyrosine derivative (CHEBI:27177) |
| droxidopa (CHEBI:31524) is a catechols (CHEBI:33566) |
| droxidopa (CHEBI:31524) is a organic molecular entity (CHEBI:50860) |
| droxidopa (CHEBI:31524) is a tyrosine derivative (CHEBI:62761) |
| IUPAC Name |
|---|
| (βR)-β,3-dihydroxy-L-tyrosine |
| INNs | Source |
|---|---|
| droxidopa | KEGG DRUG |
| droxidopa | WHO MedNet |
| droxidopa | WHO MedNet |
| droxidopum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-(2S,3R)-2-amino-3-hydroxy-3-(3,4-dihydroxyphenyl)propanoic acid | ChEBI |
| (2S,3R)-3,4-dihydroxy-phenylserine | ChEBI |
| Droxydopa | HMDB |
| L-Dihydroxyphenylserine | DrugBank |
| L-DOPS | DrugBank |
| L-threo-dihydroxyphenylserine | DrugBank |
| Brand Names | Source |
|---|---|
| Dops | KEGG DRUG |
| Northera | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 971 | DrugCentral |
| D01277 | KEGG DRUG |
| DB06262 | DrugBank |
| Droxidopa | Wikipedia |
| HMDB0015627 | HMDB |
| JP2005247828 | Patent |
| NZ579368 | Patent |
| US2008221170 | Patent |
| US2012010293 | Patent |
| US2013253061 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7112431 | Reaxys |
| CAS:23651-95-8 | ChemIDplus |
| CAS:23651-95-8 | KEGG DRUG |
| Citations |
|---|