EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36O3 |
| Net Charge | 0 |
| Average Mass | 360.538 |
| Monoisotopic Mass | 360.26645 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](OC(=O)CC)CC[C@@]34[H])[C@@]1(C)C[C@@H](C)C(=O)C2 |
| InChI | InChI=1S/C23H36O3/c1-5-21(25)26-20-9-8-17-16-7-6-15-12-19(24)14(2)13-23(15,4)18(16)10-11-22(17,20)3/h14-18,20H,5-13H2,1-4H3/t14-,15+,16+,17+,18+,20+,22+,23+/m1/s1 |
| InChIKey | NOTIQUSPUUHHEH-UXOVVSIBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dromostanolone propionate (CHEBI:31523) has functional parent metholone (CHEBI:34838) |
| dromostanolone propionate (CHEBI:31523) has role antineoplastic agent (CHEBI:35610) |
| dromostanolone propionate (CHEBI:31523) is a 3-oxo-5α-steroid (CHEBI:13601) |
| dromostanolone propionate (CHEBI:31523) is a organic molecular entity (CHEBI:50860) |
| dromostanolone propionate (CHEBI:31523) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| 2α-methyl-3-oxo-5α-androstan-17β-yl propanoate |
| Synonyms | Source |
|---|---|
| 17β-Hydroxy-2α-methyl-5α-androstan-3-one propionate | ChemIDplus |
| 2M-DHTP | ChemIDplus |
| 2MDTP | ChemIDplus |
| 2α-Methyl-4,5-dihydrotestosterone propionate | ChemIDplus |
| 32379 | ChEMBL |
| Blackburn Compound | DrugBank |
| Brand Name | Source |
|---|---|
| Masteril | ChEMBL |
| Citations |
|---|