EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H74O19 |
| Net Charge | 0 |
| Average Mass | 943.090 |
| Monoisotopic Mass | 942.48243 |
| SMILES | [H][C@]1(O[C@H]2CC[C@@]3(C)[C@]([H])(CC[C@]4([H])[C@]3([H])C[C@@H](O)[C@]3(C)[C@@H](C5=CC(=O)OC5)CC[C@@]34O)C2)C[C@H](O)[C@]([H])(O[C@H]2C[C@H](O)[C@]([H])(O[C@H]3C[C@H](O)[C@]([H])(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](C)O3)[C@@H](C)O2)[C@@H](C)O1 |
| InChI | InChI=1S/C47H74O19/c1-20-41(64-36-16-30(50)42(21(2)60-36)65-37-17-31(51)43(22(3)61-37)66-44-40(56)39(55)38(54)32(18-48)63-44)29(49)15-35(59-20)62-25-8-10-45(4)24(13-25)6-7-27-28(45)14-33(52)46(5)26(9-11-47(27,46)57)23-12-34(53)58-19-23/h12,20-22,24-33,35-44,48-52,54-57H,6-11,13-19H2,1-5H3/t20-,21-,22-,24-,25+,26-,27-,28+,29+,30+,31+,32-,33-,35+,36+,37+,38-,39+,40-,41-,42-,43-,44+,45+,46+,47+/m1/s1 |
| InChIKey | OBATZBGFDSVCJD-LALPQLPRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deslanoside (CHEBI:31468) has role anti-arrhythmia drug (CHEBI:38070) |
| deslanoside (CHEBI:31468) has role cardiotonic drug (CHEBI:38147) |
| deslanoside (CHEBI:31468) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| deslanoside (CHEBI:31468) has role metabolite (CHEBI:25212) |
| deslanoside (CHEBI:31468) is a 12β-hydroxy steroid (CHEBI:36847) |
| deslanoside (CHEBI:31468) is a 14β-hydroxy steroid (CHEBI:36862) |
| deslanoside (CHEBI:31468) is a cardenolide glycoside (CHEBI:38092) |
| deslanoside (CHEBI:31468) is a tetrasaccharide derivative (CHEBI:63567) |
| IUPAC Name |
|---|
| 3β-{[β-D-glucopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl]oxy}-12β,14-dihydroxy-5β-card-20(22)-enolide |
| INNs | Source |
|---|---|
| deslanosidum | ChemIDplus |
| deslanosido | ChemIDplus |
| deslanoside | ChemIDplus |
| Synonyms | Source |
|---|---|
| (3β,5β,12β)-3-{[β-D-glucopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl]oxy}-12,14-dihydroxycard-20(22)-enolide | ChEBI |
| deacetyllanatoside C | ChemIDplus |
| desacetyllanatoside C | ChemIDplus |
| 3-[(O-β-D-glucopyranosyl-(1→4)-O-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-O-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-O-2,6-dideoxy-β-D-ribo-hexopyranosyl)oxy]-12,14-dihydroxy-3β,5β,12β-card-20(22)-enolide | ChEBI |
| glucodigoxin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01240 | KEGG DRUG |
| DB01078 | DrugBank |
| Deslanoside | Wikipedia |
| 813 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:78187 | Beilstein |
| CAS:17598-65-1 | KEGG DRUG |
| CAS:17598-65-1 | ChemIDplus |
| Citations |
|---|