EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H74O19 |
| Net Charge | 0 |
| Average Mass | 943.090 |
| Monoisotopic Mass | 942.48243 |
| SMILES | [H][C@]1(O[C@H]2CC[C@@]3(C)[C@]([H])(CC[C@]4([H])[C@]3([H])C[C@@H](O)[C@]3(C)[C@@H](C5=CC(=O)OC5)CC[C@@]34O)C2)C[C@H](O)[C@]([H])(O[C@H]2C[C@H](O)[C@]([H])(O[C@H]3C[C@H](O)[C@]([H])(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](C)O3)[C@@H](C)O2)[C@@H](C)O1 |
| InChI | InChI=1S/C47H74O19/c1-20-41(64-36-16-30(50)42(21(2)60-36)65-37-17-31(51)43(22(3)61-37)66-44-40(56)39(55)38(54)32(18-48)63-44)29(49)15-35(59-20)62-25-8-10-45(4)24(13-25)6-7-27-28(45)14-33(52)46(5)26(9-11-47(27,46)57)23-12-34(53)58-19-23/h12,20-22,24-33,35-44,48-52,54-57H,6-11,13-19H2,1-5H3/t20-,21-,22-,24-,25+,26-,27-,28+,29+,30+,31+,32-,33-,35+,36+,37+,38-,39+,40-,41-,42-,43-,44+,45+,46+,47+/m1/s1 |
| InChIKey | OBATZBGFDSVCJD-LALPQLPRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). |
| Applications: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deslanoside (CHEBI:31468) has role anti-arrhythmia drug (CHEBI:38070) |
| deslanoside (CHEBI:31468) has role cardiotonic drug (CHEBI:38147) |
| deslanoside (CHEBI:31468) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| deslanoside (CHEBI:31468) has role metabolite (CHEBI:25212) |
| deslanoside (CHEBI:31468) is a 12β-hydroxy steroid (CHEBI:36847) |
| deslanoside (CHEBI:31468) is a 14β-hydroxy steroid (CHEBI:36862) |
| deslanoside (CHEBI:31468) is a cardenolide glycoside (CHEBI:38092) |
| deslanoside (CHEBI:31468) is a tetrasaccharide derivative (CHEBI:63567) |
| IUPAC Name |
|---|
| 3β-{[β-D-glucopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl]oxy}-12β,14-dihydroxy-5β-card-20(22)-enolide |
| INNs | Source |
|---|---|
| deslanoside | ChemIDplus |
| deslanosido | ChemIDplus |
| deslanosidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-[(O-β-D-glucopyranosyl-(1→4)-O-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-O-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-O-2,6-dideoxy-β-D-ribo-hexopyranosyl)oxy]-12,14-dihydroxy-3β,5β,12β-card-20(22)-enolide | ChEBI |
| (3β,5β,12β)-3-{[β-D-glucopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl]oxy}-12,14-dihydroxycard-20(22)-enolide | ChEBI |
| deacetyllanatoside C | ChemIDplus |
| desacetyllanatoside C | ChemIDplus |
| glucodigoxin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 813 | DrugCentral |
| D01240 | KEGG DRUG |
| DB01078 | DrugBank |
| Deslanoside | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:78187 | Beilstein |
| CAS:17598-65-1 | KEGG DRUG |
| CAS:17598-65-1 | ChemIDplus |
| Citations |
|---|