EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H35NO10 |
| Net Charge | 0 |
| Average Mass | 569.607 |
| Monoisotopic Mass | 569.22610 |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C30H35NO10/c1-14(2)7-8-16-13-17(9-11-19(16)32)27(36)31-21-22(33)18-10-12-20(15(3)25(18)40-28(21)37)39-29-24(35)23(34)26(38-6)30(4,5)41-29/h7,9-13,23-24,26,29,32-35H,8H2,1-6H3,(H,31,36)/t23-,24+,26+,29+/m0/s1 |
| InChIKey | UZHGFJZFJRMSOS-NANZAVOOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| descarbamoylnovobiocin (CHEBI:31467) has role metabolite (CHEBI:25212) |
| descarbamoylnovobiocin (CHEBI:31467) is a benzamides (CHEBI:22702) |
| descarbamoylnovobiocin (CHEBI:31467) is a hexoside (CHEBI:35313) |
| descarbamoylnovobiocin (CHEBI:31467) is a hydroxycoumarin (CHEBI:37912) |
| descarbamoylnovobiocin (CHEBI:31467) is a monosaccharide derivative (CHEBI:63367) |
| descarbamoylnovobiocin (CHEBI:31467) is conjugate acid of descarbamoylnovobiocin(1−) (CHEBI:73955) |
| Incoming Relation(s) |
| descarbamoylnovobiocin(1−) (CHEBI:73955) is conjugate base of descarbamoylnovobiocin (CHEBI:31467) |
| IUPAC Name |
|---|
| N-{7-[(6-deoxy-5-methyl-4-O-methyl-β-D-gulopyranosyl)oxy]-4-hydroxy-8-methyl-2-oxo-2H-chromen-3-yl}-4-hydroxy-3-(3-methylbut-2-en-1-yl)benzamide |
| Synonyms | Source |
|---|---|
| Descarbamoylnovobiocin | KEGG COMPOUND |
| decarbamoylnovobiocin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C12476 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6552957 | Reaxys |
| CAS:10544-02-2 | ChemIDplus |
| Citations |
|---|