EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O4S |
| Net Charge | 0 |
| Average Mass | 341.433 |
| Monoisotopic Mass | 341.14093 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)C1(N)CCCCC1 |
| InChI | InChI=1S/C15H23N3O4S/c1-14(2)9(12(20)21)18-10(19)8(11(18)23-14)17-13(22)15(16)6-4-3-5-7-15/h8-9,11H,3-7,16H2,1-2H3,(H,17,22)(H,20,21)/t8-,9+,11-/m1/s1 |
| InChIKey | HGBLNBBNRORJKI-WCABBAIRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclacillin (CHEBI:31444) has role antibacterial drug (CHEBI:36047) |
| cyclacillin (CHEBI:31444) is a penicillin (CHEBI:17334) |
| IUPAC Name |
|---|
| 6β-(1-aminocyclohexanecarboxamido)-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| ciclacilina | ChemIDplus |
| ciclacillin | KEGG DRUG |
| ciclacilline | ChemIDplus |
| ciclacillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1-aminocyclohexyl)penicillin | ChemIDplus |
| (2S,5R,6R)-6-{[(1-aminocyclohexyl)carbonyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| 6-(1-aminocyclohexanecarboxamido)penicillanic acid | ChemIDplus |
| 6-(1-aminocyclohexylcarboxamido)penicillanic acid | ChemIDplus |
| Cyclacillin | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Bastcillin | DrugBank |
| Calthor | DrugBank |
| Citosarin | DrugBank |
| Cyclapen | DrugBank |
| Cyclapen-W | KEGG DRUG |
| Syngacillin | DrugBank |