EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17NO |
| Net Charge | 0 |
| Average Mass | 203.285 |
| Monoisotopic Mass | 203.13101 |
| SMILES | CC=CC(=O)N(CC)c1ccccc1C |
| InChI | InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3 |
| InChIKey | DNTGGZPQPQTDQF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | scabicide An acaricide that kills mites of the genus Sarcoptes. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crotamiton (CHEBI:31439) has role antipruritic drug (CHEBI:59683) |
| crotamiton (CHEBI:31439) has role scabicide (CHEBI:73333) |
| crotamiton (CHEBI:31439) is a enamide (CHEBI:51751) |
| crotamiton (CHEBI:31439) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-ethyl-N-(2-methylphenyl)but-2-enamide |
| INNs | Source |
|---|---|
| crotamiton | ChemIDplus |
| crotamitonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| crotalgin | DrugBank |
| crotamitone | DrugBank |
| crotonyl-N-ethyl-o-toluidine | ChemIDplus |
| N-ethyl-o-crotonotoluidide | ChemIDplus |