EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO5 |
| Net Charge | 0 |
| Average Mass | 317.341 |
| Monoisotopic Mass | 317.12632 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@H]3O[C@@H]3[C@]13CC[N@@]2Cc1c3cc2c(c1OC)OCO2 |
| InChI | InChI=1S/C17H19NO5/c1-20-13-8-6-18-3-2-17(9(8)4-11-15(13)22-7-21-11)12(18)5-10(19)14-16(17)23-14/h4,10,12,14,16,19H,2-3,5-7H2,1H3/t10-,12-,14+,16+,17+/m1/s1 |
| InChIKey | HHEOZJCKMANJQV-CUQLUGJVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Crinamidine (CHEBI:31436) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Crinamidine | KEGG COMPOUND |