EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H42N6O18 |
| Net Charge | 0 |
| Average Mass | 882.789 |
| Monoisotopic Mass | 882.25556 |
| SMILES | C[C@H]1OC(=O)[C@@H](NC(=O)CNC(=O)c2cccc(O)c2O)[C@@H](C)OC(=O)[C@@H](NC(=O)CNC(=O)c2cccc(O)c2O)[C@@H](C)OC(=O)[C@H]1NC(=O)CNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C39H42N6O18/c1-16-28(43-25(49)13-40-34(55)19-7-4-10-22(46)31(19)52)37(58)62-18(3)30(45-27(51)15-42-36(57)21-9-6-12-24(48)33(21)54)39(60)63-17(2)29(38(59)61-16)44-26(50)14-41-35(56)20-8-5-11-23(47)32(20)53/h4-12,16-18,28-30,46-48,52-54H,13-15H2,1-3H3,(H,40,55)(H,41,56)(H,42,57)(H,43,49)(H,44,50)(H,45,51)/t16-,17-,18-,28+,29+,30+/m1/s1 |
| InChIKey | RCQTVEFBFUNTGM-BDVHUIKKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (11112781) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corynebactin (CHEBI:31432) has role bacterial metabolite (CHEBI:76969) |
| corynebactin (CHEBI:31432) has role metabolite (CHEBI:25212) |
| corynebactin (CHEBI:31432) is a catechols (CHEBI:33566) |
| corynebactin (CHEBI:31432) is a crown compound (CHEBI:37409) |
| corynebactin (CHEBI:31432) is a macrocyclic lactone (CHEBI:63944) |
| IUPAC Name |
|---|
| N,N',N''-{[(2R,3S,6R,7S,10R,11S)-2,6,10-trimethyl-4,8,12-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl]tris[imino(2-oxoethane-2,1-diyl)]}tris(2,3-dihydroxybenzamide) |
| Synonyms | Source |
|---|---|
| 2,3-dihydroxybenzoate-glycine-threonine trimeric ester | ChEBI |
| Bacillibactin | KEGG COMPOUND |
| Corynebactin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| corynebactin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Bacillibactin | Wikipedia |
| C12219 | KEGG COMPOUND |
| CPD-9984 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10414456 | Reaxys |
| CAS:95536-41-7 | KEGG COMPOUND |
| CAS:95536-41-7 | ChemIDplus |
| Citations |
|---|