EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31431 - Copper gluconate
| Formula | 2C6H11O7.Cu |
| Net Charge | 0 |
| Average Mass | 453.840 |
| Monoisotopic Mass | 453.03055 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Cu+2] |
| InChI | InChI=1S/2C6H12O7.Cu/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChIKey | OCUCCJIRFHNWBP-IYEMJOQQSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Copper gluconate (CHEBI:31431) has role antineoplastic agent (CHEBI:35610) |
| Copper gluconate (CHEBI:31431) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Copper (as gluconate) | ChEMBL |
| Copper d-gluconate (1:2) | ChEMBL |
| Copper gluconate | KEGG COMPOUND |
| Copper(ii) gluconate | ChEMBL |
| Copper(ii)gluconate | ChEMBL |
| Cupric gluconate | ChEMBL |