EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO8.HCl |
| Net Charge | 0 |
| Average Mass | 546.101 |
| Monoisotopic Mass | 545.27555 |
| SMILES | Cl.[H][C@@]12[C@H](OC(=O)CCN(C)C)[C@H](OC(C)=O)[C@@]3(C)O[C@@](C)(C=C)CC(=O)[C@]3(O)[C@@]1(C)[C@@H](O)CCC2(C)C |
| InChI | InChI=1S/C27H43NO8.ClH/c1-10-24(5)15-18(31)27(33)25(6)17(30)11-13-23(3,4)21(25)20(35-19(32)12-14-28(8)9)22(34-16(2)29)26(27,7)36-24;/h10,17,20-22,30,33H,1,11-15H2,2-9H3;1H/t17-,20-,21-,22-,24-,25-,26+,27-;/m0./s1 |
| InChIKey | VIRRLEDAYYYTOD-YHEOSNBFSA-N |
| Roles Classification |
|---|
| Biological Role: | adenylate cyclase agonist Any agonist of one or more of the isoforms of adenylate cyclase (EC 4.6.1.1). |
| Applications: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colforsin daropate hydrochloride (CHEBI:31429) has part colforsin daropate(1+) (CHEBI:166832) |
| colforsin daropate hydrochloride (CHEBI:31429) has role adenylate cyclase agonist (CHEBI:78548) |
| colforsin daropate hydrochloride (CHEBI:31429) has role antihypertensive agent (CHEBI:35674) |
| colforsin daropate hydrochloride (CHEBI:31429) has role cardiotonic drug (CHEBI:38147) |
| colforsin daropate hydrochloride (CHEBI:31429) has role vasodilator agent (CHEBI:35620) |
| colforsin daropate hydrochloride (CHEBI:31429) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-benzo[f]chromen-6-yl N,N-dimethyl-β-alaninate hydrochloride |
| Synonyms | Source |
|---|---|
| colforsin dapropate hydrochloride | DrugCentral |
| NKH 477 | ChemIDplus |
| 6-(3-dimethylaminopropionyl)forskolin hydrochloride | ChEBI |
| colforsin dapropate HCl | ChemIDplus |
| colforsin daropate hydrochloride | ChemIDplus |
| colforsin daropate HCl | DrugCentral |
| Brand Name | Source |
|---|---|
| Adehl | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:138605-00-2 | ChemIDplus |
| Citations |
|---|