EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO8.HCl |
| Net Charge | 0 |
| Average Mass | 546.101 |
| Monoisotopic Mass | 545.27555 |
| SMILES | Cl.[H][C@@]12[C@H](OC(=O)CCN(C)C)[C@H](OC(C)=O)[C@@]3(C)O[C@@](C)(C=C)CC(=O)[C@]3(O)[C@@]1(C)[C@@H](O)CCC2(C)C |
| InChI | InChI=1S/C27H43NO8.ClH/c1-10-24(5)15-18(31)27(33)25(6)17(30)11-13-23(3,4)21(25)20(35-19(32)12-14-28(8)9)22(34-16(2)29)26(27,7)36-24;/h10,17,20-22,30,33H,1,11-15H2,2-9H3;1H/t17-,20-,21-,22-,24-,25-,26+,27-;/m0./s1 |
| InChIKey | VIRRLEDAYYYTOD-YHEOSNBFSA-N |
| Roles Classification |
|---|
| Biological Role: | adenylate cyclase agonist Any agonist of one or more of the isoforms of adenylate cyclase (EC 4.6.1.1). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colforsin daropate hydrochloride (CHEBI:31429) has part colforsin daropate(1+) (CHEBI:166832) |
| colforsin daropate hydrochloride (CHEBI:31429) has role adenylate cyclase agonist (CHEBI:78548) |
| colforsin daropate hydrochloride (CHEBI:31429) has role antihypertensive agent (CHEBI:35674) |
| colforsin daropate hydrochloride (CHEBI:31429) has role cardiotonic drug (CHEBI:38147) |
| colforsin daropate hydrochloride (CHEBI:31429) has role vasodilator agent (CHEBI:35620) |
| colforsin daropate hydrochloride (CHEBI:31429) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-benzo[f]chromen-6-yl N,N-dimethyl-β-alaninate hydrochloride |
| Synonyms | Source |
|---|---|
| (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-5-(acetyloxy)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxododecahydro-1H-naphtho[2,1-b]pyran-6-yl N,N-dimethyl-β-alaninate—hydrogen chloride | IUPAC |
| 6-(3-dimethylaminopropionyl)forskolin hydrochloride | ChEBI |
| colforsin dapropate HCl | ChemIDplus |
| colforsin dapropate hydrochloride | DrugCentral |
| colforsin daropate HCl | DrugCentral |
| colforsin daropate hydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Adehl | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:138605-00-2 | ChemIDplus |
| Citations |
|---|